Hi, in case it's useful to anyone a dwm-1.6 version of my
large numbers of clients diff (including a dotile() which
allows more columns for xinerama).
Hi, Anselm: not totally clear what the weight assignments are:
for any tiled client, its weight is precisely the numerically lowest
set tag?
The only noteworthy thing is that I've discovered that once
I've got a (hacky) function for moving clients to general
positions (eg, 2nd, 5th, etc) rather than just the `1st' that
zoom provides I don't feel the need to start the layout in
middle of screen, so that complexity goes away.
As ususal, patchDoc.txt contains brief description.
cheers, dave tweed
diff -u --new-file dwm-1.6/config.default.h dwm-1.6.modified/config.default.h
--- dwm-1.6/config.default.h 2006-09-16 10:20:20.000000000 +0100
+++ dwm-1.6.modified/config.default.h 2006-09-16 20:18:20.000000000 +0100
@@ -21,6 +21,8 @@
#define MODKEY Mod1Mask
#define MASTERW 60 /* percent */
+#define NO_MONITORS 2 /* only correct for 1 or 2 */
+
#define KEYS \
static Key key[] = { \
/* modifier key function arguments */ \
@@ -29,8 +31,6 @@
{ MODKEY|ShiftMask, XK_Tab, focusprev, { 0 } }, \
{ MODKEY, XK_Return, zoom, { 0 } }, \
{ MODKEY, XK_m, togglemax, { 0 } }, \
- { MODKEY, XK_g, resizecol, { .i = 20 } }, \
- { MODKEY, XK_s, resizecol, { .i = -20 } }, \
{ MODKEY|ShiftMask, XK_1, tag, { .i = 0 } }, \
{ MODKEY|ShiftMask, XK_2, tag, { .i = 1 } }, \
{ MODKEY|ShiftMask, XK_3, tag, { .i = 2 } }, \
@@ -42,7 +42,7 @@
{ MODKEY|ControlMask|ShiftMask, XK_4, toggletag, { .i = 3 } }, \
{ MODKEY|ControlMask|ShiftMask, XK_5, toggletag, { .i = 4 } }, \
{ MODKEY|ShiftMask, XK_c, killclient, { 0 } }, \
- { MODKEY, XK_space, togglemode, { 0 } }, \
+ { MODKEY, XK_f, togglemode, { 0 } }, \
{ MODKEY, XK_0, viewall, { 0 } }, \
{ MODKEY, XK_1, view, { .i = 0 } }, \
{ MODKEY, XK_2, view, { .i = 1 } }, \
@@ -55,6 +55,33 @@
{ MODKEY|ControlMask, XK_4, toggleview, { .i = 3 } }, \
{ MODKEY|ControlMask, XK_5, toggleview, { .i = 4 } }, \
{ MODKEY|ShiftMask, XK_q, quit, { 0 } }, \
+ { MODKEY|ControlMask, XK_n, adjustnumbercols, { .i=1 } }, \
+ { MODKEY|ControlMask|ShiftMask, XK_n, adjustnumbercols, { .i=-1 } }, \
+ { MODKEY, XK_n, adjustcoltypes, { .i=1 } }, \
+ { MODKEY|ShiftMask, XK_n, adjustcoltypes, { .i=-1 } }, \
+ { MODKEY, XK_s, sortallbytitle, { 0 } }, \
+ { MODKEY, XK_p, setAndJump, { .i=1 } }, \
+ { MODKEY|ShiftMask, XK_p, unsetAndJump, { .i=-1 } }, \
+ { MODKEY|ControlMask, XK_p, setwithnexttag, { .i=1 } }, \
+ { MODKEY|ControlMask|ShiftMask, XK_p, zapcurrenttag, { .i=-1 } }, \
+ { MODKEY, XK_o, setAndJump, { .i=-1 } }, \
+ { MODKEY|ShiftMask, XK_o, unsetAndJump, { .i=1 } }, \
+ { MODKEY|ControlMask, XK_o, setwithnexttag, { .i=-1 } }, \
+ { MODKEY|ControlMask|ShiftMask, XK_o, zapcurrenttag, { .i=1 } }, \
+ { MODKEY, XK_space, movewrtcurrenttag, { .i=1 } }, \
+ { MODKEY|ShiftMask, XK_space, movewrtcurrenttag, { .i=-1 } }, \
+ { MODKEY|ControlMask, XK_space, pushAllClients, { .i=1 } }, \
+ { MODKEY|ControlMask|ShiftMask, XK_space, pushAllClients, { .i=-1 } }, \
+ { MODKEY, XK_l, popcurrenttag, { 0 } }, \
+ { MODKEY, XK_F1, moveToPosn, {.i=1} },\
+ { MODKEY, XK_F2, moveToPosn, {.i=2} },\
+ { MODKEY, XK_F3, moveToPosn, {.i=3} },\
+ { MODKEY, XK_F4, moveToPosn, {.i=4} },\
+ { MODKEY, XK_F5, moveToPosn, {.i=5} },\
+ { MODKEY, XK_F6, moveToPosn, {.i=6} },\
+ { MODKEY, XK_F7, moveToPosn, {.i=7} },\
+ { MODKEY, XK_F8, moveToPosn, {.i=8} },\
+ { MODKEY, XK_F9, moveToPosn, {.i=9} },\
};
/* Query class:instance:title for regex matching info with following command:
diff -u --new-file dwm-1.6/dwm.h dwm-1.6.modified/dwm.h
--- dwm-1.6/dwm.h 2006-09-16 10:20:20.000000000 +0100
+++ dwm-1.6.modified/dwm.h 2006-09-16 20:06:14.000000000 +0100
@@ -91,6 +91,19 @@
Window twin;
};
+static
+inline
+int
+clamp(int x,int lo,int hi)
+{
+ if(x<lo){
+ return lo;
+ }else if(x>hi){
+ return hi;
+ }
+ return x;
+}
+
extern const char *tags[]; /* all tags */
extern char stext[1024]; /* status text */
extern int bx, by, bw, bh, bmw; /* bar geometry, bar mode label width */
@@ -145,6 +158,13 @@
extern void settags(Client *c, Client *trans); /* sets tags of c */
extern void tag(Arg *arg); /* tags c with arg's index */
extern void toggletag(Arg *arg); /* toggles c tags with arg's index */
+extern void setwithnexttag(Arg *arg); /* set highestTag+arg->i on client */
+extern void popcurrenttag(Arg *arg); /* unset highestTag+arg->i on client */
+extern void movewrtcurrenttag(Arg *arg); /*deselect highestTag & select highestTag+arg->i */
+extern void zapcurrenttag(Arg *arg); /* unset highestTag from all clients (if possible) */
+extern void setAndJump(Arg *arg); /* set highestTag+arg->i on client and move to it*/
+extern void unsetAndJump(Arg *arg); /* unset highestTag on client & move to highestTag+arg->i */
+extern void pushAllClients(Arg *arg); /*apply highestTag+arg->i to all clients */
/* util.c */
extern void *emallocz(unsigned int size); /* allocates zero-initialized memory, exits on error */
@@ -166,3 +186,7 @@
extern void view(Arg *arg); /* views the tag with arg's index */
extern void viewall(Arg *arg); /* views all tags, arg is ignored */
extern void zoom(Arg *arg); /* zooms the focused client to master column, arg is ignored */
+extern void adjustnumbercols(Arg *arg); /* change number of columns */
+extern void adjustcoltypes(Arg *arg); /* increment/decrement number of full columns */
+extern void sortallbytitle(Arg *arg); /*sort all clients in title order */
+extern void moveToPosn(Arg *arg); /* put client at position arg->i (restrictions) */
diff -u --new-file dwm-1.6/patchDoc.txt dwm-1.6.modified/patchDoc.txt
--- dwm-1.6/patchDoc.txt 1970-01-01 01:00:00.000000000 +0100
+++ dwm-1.6.modified/patchDoc.txt 2006-09-16 20:20:14.000000000 +0100
@@ -0,0 +1,65 @@
+This patch includes some functions I find useful for working with
+large setups, particularly xinerama. There is a #define in
+config.h NO_MONITORS which can be set to 1 or 2. (The
+formulae used are incorrect for more than 2 monitors.)
+
+Note the column width adjust keybindings have been removed
+because they don't work under the modified tiling code. Also,
+the `float toggle' has been remapped to ModKey-f to make
+the space key available for new functionality.
+
+Firstly, the number of
+columns on the screen is totally dynamic and can be increased
+(with ModKey-n) or decreased (with ModKey-Shift-n). Given the
+current number of columns, if NO_MONITORS is 1 or there are
+an even number of columns, all columns are assigned the same
+width. If NO_MONITORS is 2 with an odd number of columns,
+then floor(no cols/2) will be placed on left screen and
+ceil(no cols/2) will be placed on the right screen. (Might
+get 1-2 pixel rounding errors at various points.) In addition
+to the total number of columns, the number of `full columns'
+versus `stack columns' can be increased (with ModKey-b) or
+decreased (with ModKey-Shift-b).
+
+Other than increasing the total number, types and widths of
+columns, the tiling algorithm should be functionally equivalent
+to the mainstream dwm layout algorithm, except for one final
+wrinkle: when NO_MONITORS is 2 the display is essentially
+`wrapped around' by floor(noCols/4) in an attempt to put
+the zoomed column (which is what the user is presumably
+primarily working with) towards the centre of the overall
+display, rather than stuck on the far left side of the two
+monitors. causing the neck to be constantly slightly turned.
+If you dislike this behaviour you can disable it by making
+the initial assignment to `slideCol' in dotile() unconditionally 0.
+
+Secondly, ModKey-s sorts all the clients by title name.
+
+The keys ModKey-Fx for x=1..9 will move the selected
+client into position x in the dislayed list.
+
+For the final commands, it will be less confusing if we
+define the HI_TAG as the highest tag being currently
+viewed. (If only one tag is being viewed, it is the current
+tag.) ModKey-p sets HI_TAG+1 on the current client (keeping
+any existing tags). This is so that multiple ModKey-p's
+pushes the SAME tag onto all the clients. Mod-Shift-p
+removes HI_TAG from the current client (which effectively
+banishes is). These basic versions also deselect HI_TAG
+and move to HI_TAG+1. Adding the Ctrl modifier to these
+just modifies the selected client without moving. (I find I
+tend to use the `select and move' version most frequently.)
+Similar interpretation applies to `o', except in the opposite
+direction.
+
+ModKey-Ctrl-Shift-o
+removes HI_TAG from all clients UNLESS that is their last tag,
+for which clients it does nothing. If it managed to
+remove HI_TAG from all clients which have it, it sets
+the HI_TAG-1 in the selected views and rearranges.
+
+This is all rather abstract: the workflow I use it for is
+to `push' a subset of the current clients onto a new,
+scratch view (eg, to concentrate on something),
+work with them for a while, then pop the temporary
+view out of existance and fall back to the original.
diff -u --new-file dwm-1.6/tag.c dwm-1.6.modified/tag.c
--- dwm-1.6/tag.c 2006-09-16 10:20:20.000000000 +0100
+++ dwm-1.6.modified/tag.c 2006-09-16 20:07:43.000000000 +0100
@@ -137,3 +137,124 @@
sel->weight = (i == ntags) ? arg->i : i;
arrange(NULL);
}
+/* begin changes and additions */
+
+/* find the highest currently viewed tag */
+int
+highestTagUsed()
+{
+ int i;
+ for(i=ntags-1;i>=0;--i){
+ if(seltag[i]){
+ return i;
+ }
+ }
+ return 0; /*should never happen*/
+}
+
+/*take care of updating the weight*/
+void
+flipTag(Client *c,int idx)
+{
+ c->tags[idx]=True;
+ if(idx<c->weight){
+ c->weight=idx;
+ }
+}
+
+void
+setwithnexttag(Arg *arg)
+{
+ if(sel){
+ flipTag(sel,clamp(highestTagUsed()+arg->i,0,ntags-1));
+ arrange(NULL);
+ }
+}
+
+void
+pushAllClients(Arg *arg)
+{
+ int hiTag=highestTagUsed(),toSet=hiTag+arg->i;
+ if(toSet>=0 && toSet<ntags){
+ Client *c;
+ for(c = clients; c; c = c->next) {
+ if(c->tags[hiTag]){/* prevent potentially much pointless work */
+ flipTag(c,toSet);
+ }
+ }
+ movewrtcurrenttag(arg);
+ }
+}
+
+void
+setAndJump(Arg *arg)
+{
+ /* arg->i is +/-1*/
+ setwithnexttag(arg);
+ movewrtcurrenttag(arg);
+}
+
+void
+unsetAndJump(Arg *arg)
+{
+ /* arg->i is +/-1*/
+ popcurrenttag(arg);
+ movewrtcurrenttag(arg);
+}
+
+Bool
+unsetspecifiedtag(Client *c,int toZap)
+{
+ int i;
+ c->tags[toZap]=False;
+ for(i = 0; i < ntags && !c->tags[i]; i++) /*do nothing*/;
+
+ if(i == ntags){ /* oops: wiped out last tag */
+ c->tags[toZap] = True;
+ c->weight=toZap;
+ return False;
+ }else{
+ c->weight=i;
+ return True;
+ }
+}
+
+void
+popcurrenttag(Arg *arg)
+{
+ if(sel && unsetspecifiedtag(sel,highestTagUsed())){
+ arrange(NULL);
+ }
+}
+
+void
+movewrtcurrenttag(Arg *arg)
+{
+ int curTag=highestTagUsed();
+ if(arg && (arg->i!=1 || curTag!=ntags-1) && (arg->i!=-1 || curTag!=0)){
+ seltag[curTag]=False;
+ seltag[curTag+arg->i]=True;
+ arrange(NULL);
+ }
+}
+
+void
+zapcurrenttag(Arg *arg)
+{
+ /* require arg.i=+/- 1 */
+ Client *c;
+ int toZap=highestTagUsed();
+ Bool ok=True;
+ for(c = clients; c; c = c->next) {
+ if(c->tags[toZap]){/* prevent potentially much pointless work */
+ ok=ok && unsetspecifiedtag(c,toZap);
+ }
+ }
+ int dest=toZap+arg->i;
+ if(ok && dest>=0 && dest<ntags){
+ seltag[toZap]=False;
+ seltag[dest]=True;
+ }
+ arrange(NULL);
+}
+/* end changes and additions */
diff -u --new-file dwm-1.6/view.c dwm-1.6.modified/view.c
--- dwm-1.6/view.c 2006-09-16 10:20:20.000000000 +0100
+++ dwm-1.6.modified/view.c 2006-09-16 20:09:26.000000000 +0100
@@ -6,6 +6,8 @@
/* static */
+typedef Client* (*MinFP)();
+
static Client *
minclient() {
Client *c, *min;
@@ -19,11 +21,11 @@
}
static void
-reorder() {
+reorder(MinFP fp) {
Client *c, *newclients, *tail;
newclients = tail = NULL;
- while((c = minclient())) {
+ while((c = (*fp)())) {
detach(c);
if(tail) {
c->prev = tail;
@@ -77,69 +79,166 @@
restack();
}
-void
-dotile(Arg *arg) {
- int h, i, n, w;
- Client *c;
-
- maximized = False;
+/* begin changes and additions */
+static const int MAX_COLS=8;
+static int noCols=2;
+static int noStackCols=1;
+
+/* change the total number of columns */
+void
+adjustnumbercols(Arg *arg)
+{
+ if(arg && (arg->i!=1 || noCols!=MAX_COLS) && (arg->i!=-1 || noCols!=1)){
+ noCols+=arg->i;
+ noStackCols=noCols-1;
+ arrange(NULL);
+ }
+}
+
+/* change the balance between number of full and stacked columns */
+void
+adjustcoltypes(Arg *arg)
+{
+ if(arg && (arg->i!=1 || noStackCols!=0) && (arg->i!=-1 || noStackCols!=noCols)){
+ noStackCols-=arg->i;
+ arrange(NULL);
+ }
+}
+
+/*****************************************************************************
+ * for moment, restrict to either 1 or 2 monitor setup
+ * first build width/height tables, then fill them rather than merge two
+ * to into combined code to ease future experiments
+ * peculiarities:
+ * if
+ ****************************************************************************/
+void
+dotile(Arg *arg)
+{
+ int n, i;
+ Client *c;
+
+ maximized = False;
+
+ for(n = 0, c = clients; c; c = c->next)
+ if(isvisible(c) && !c->isfloat)
+ n++;
+ int noStackColsP=noStackCols; /* no stacks we'll actually use this time */
+ int noInSCols=n-(noCols-noStackColsP); /* no clients in stack cols */
+ int nP = clamp(n,1,noCols); /* no cols actually used on this view */
+ while(!(noInSCols*bh <= (sh-bh)*noStackColsP) && noInSCols>0){ /* inc stack cols until fits */
+ ++noStackColsP;
+ noInSCols=n-(noCols-noStackColsP);
+ }
+ Bool useNonTrivialCols=noStackColsP>0 && n >= noCols
+ && noInSCols*bh <= (sh-bh)*noStackColsP; /* got enough height for at least titles? */
+ int noOfShortCols = noCols - noInSCols%noStackColsP;
+ /* build tables of essential layout parameters */
+ int colEndOn[MAX_COLS],heights[MAX_COLS],widths[MAX_COLS];
+ for(i = 0; i < nP; ++i){
+ heights[i] = sh-bh;/* default to every column full height */
+ if(useNonTrivialCols && i>=noCols-noStackColsP){
+ int no = noInSCols/noStackColsP + (i>=noOfShortCols?1:0); /* no clients in this col */
+ heights[i] /= no;
+ colEndOn[i] = no + (i==0 ?-1:colEndOn[i-1]);/* col i finishes on this client */
+ }else{
+ colEndOn[i] = i;
+ }
+ int div=nP;
+ if(NO_MONITORS>1 && nP%2!=0 && nP>1){
+ div+=(i<nP/2 ? -1 : +1);
+ }
+ widths[i]=sw/div;
+ }
+ colEndOn[nP-1]=n-1; /* ensure final column ends with last client*/
+ /* use tables to assign actual client positions in layout */
+ int colNo = 0, cumHgt = sy + bh, cumWid=0;
+ for(i = 0, c = clients; c; c = c->next) {
+ if(isvisible(c)) {
+ if(c->isfloat) {
+ resize(c, True, TopLeft);
+ continue;
+ }
+ c->x = cumWid;
+ c->y = cumHgt;
+ c->w = widths[colNo] - 2;
+ c->h = heights[colNo] - 2;
+ if(i == colEndOn[colNo]){ /* next client starts a new column */
+ c->h = sh - 2 - c->y; /* soak up rounding down error pixels */
+ cumWid+=widths[colNo];
+ ++colNo;
+ cumHgt = sy + bh;
+ }else if(useNonTrivialCols){
+ cumHgt += heights[colNo];
+ }
+ resize(c, False, TopLeft);
+ i++;
+ }
+ else
+ ban(c);
+ }
+ if(!sel || !isvisible(sel))
+ sel = getnext(clients);
+ if(sel)
+ focus(sel);
+ else
+ XSetInputFocus(dpy, root, RevertToPointerRoot, CurrentTime);
+ restack();
+}
- w = sw - mw;
- for(n = 0, c = clients; c; c = c->next)
- if(isvisible(c) && !c->isfloat)
- n++;
+static Client *
+minname()
+{
+ Client *c, *min;
- if(n > 1)
- h = (sh - bh) / (n - 1);
- else
- h = sh - bh;
+ for(min = c = clients; c; c = c->next)
+ if(strncasecmp(c->name,min->name,sizeof(c->name))<0)
+ min = c;
+ return min;
+}
- for(i = 0, c = clients; c; c = c->next) {
- if(isvisible(c)) {
- if(c->isfloat) {
- resize(c, True, TopLeft);
- continue;
- }
- if(n == 1) {
- c->x = sx;
- c->y = sy + bh;
- c->w = sw - 2;
- c->h = sh - 2 - bh;
- }
- else if(i == 0) {
- c->x = sx;
- c->y = sy + bh;
- c->w = mw - 2;
- c->h = sh - 2 - bh;
- }
- else if(h > bh) {
- c->x = sx + mw;
- c->y = sy + (i - 1) * h + bh;
- c->w = w - 2;
- if(i + 1 == n)
- c->h = sh - c->y - 2;
- else
- c->h = h - 2;
- }
- else { /* fallback if h < bh */
- c->x = sx + mw;
- c->y = sy + bh;
- c->w = w - 2;
- c->h = sh - 2 - bh;
- }
- resize(c, False, TopLeft);
- i++;
- }
- else
- ban(c);
- }
- if(!sel || !isvisible(sel)) {
- for(c = stack; c && !isvisible(c); c = c->snext);
- focus(c);
- }
- restack();
+/* sort all the clients (whether displayed or not) by title */
+void
+sortallbytitle(Arg *arg)
+{
+ reorder(&minname);
+ arrange(NULL);
+}
+
+//precondition: arg must have .i set to integer >=1
+void
+moveToPosn(Arg *arg)
+{
+ unsigned int n;
+ Client *c,*d=0;//we'll re-insert just after client d
+ if(arg->i==0 || !sel || !clients || sel==clients || sel->isfloat || arrange!=dotile || maximized){
+ return;
+ }
+ for(n = 0, c = clients; c; c = c->next){
+ if(isvisible(c) && !c->isfloat){
+ if(n==arg->i-1){
+ d=c;
+ }
+ n++;
+ }
+ }
+ c=sel;
+ if(!d || c==d || clients==d){//situation we can't/shouldn't deal with
+ return;
+ }
+ detach(c);
+ c->next=d->next;
+ c->prev=d;
+ c->prev->next=c;
+ if(c->next){
+ c->next->prev=c;
+ }
+ focus(c);
+ arrange(NULL);
}
+/* end changes and additions */
+
void
focusnext(Arg *arg) {
Client *c;
@@ -246,7 +345,7 @@
for(i = 0; i < ntags && !seltag[i]; i++);
if(i == ntags)
seltag[arg->i] = True; /* cannot toggle last view */
- reorder();
+ reorder(&minclient);
arrange(NULL);
}
@@ -257,7 +356,7 @@
for(i = 0; i < ntags; i++)
seltag[i] = False;
seltag[arg->i] = True;
- reorder();
+ reorder(&minclient);
arrange(NULL);
}
@@ -267,7 +366,7 @@
for(i = 0; i < ntags; i++)
seltag[i] = True;
- reorder();
+ reorder(&minclient);
arrange(NULL);
}
