1 new commit in pytest:
https://bitbucket.org/pytest-dev/pytest/commits/9c7946ebb69c/
Changeset: 9c7946ebb69c
User: RonnyPfannschmidt
Date: 2015-02-28 09:02:58+00:00
Summary: Merged in issue616 (pull request #252)
fix issue616 - conftest visibility fixes.
Affected #: 13 files
diff -r f7f076b07d105d2fceeb38c998910be33f9fe290 -r
9c7946ebb69c7d4c778e5e6c46e026ca715ae18d CHANGELOG
--- a/CHANGELOG
+++ b/CHANGELOG
@@ -1,6 +1,20 @@
2.7.0.dev (compared to 2.6.4)
-----------------------------
+- fix issue616: conftest.py files and their contained fixutres are now
+ properly considered for visibility, independently from the exact
+ current working directory and test arguments that are used.
+ Many thanks to Eric Siegerman and his PR235 which contains
+ systematic tests for conftest visibility and now passes.
+ This change also introduces the concept of a ``rootdir`` which
+ is printed as a new pytest header and documented in the pytest
+ customize web page.
+
+- change reporting of "diverted" tests, i.e. tests that are collected
+ in one file but actually come from another (e.g. when tests in a test class
+ come from a base class in a different file). We now show the nodeid
+ and indicate via a postfix the other file.
+
- add ability to set command line options by environment variable
PYTEST_ADDOPTS.
- added documentation on the new pytest-dev teams on bitbucket and
diff -r f7f076b07d105d2fceeb38c998910be33f9fe290 -r
9c7946ebb69c7d4c778e5e6c46e026ca715ae18d _pytest/config.py
--- a/_pytest/config.py
+++ b/_pytest/config.py
@@ -657,6 +657,12 @@
sys.stderr.write("INTERNALERROR> %s\n" %line)
sys.stderr.flush()
+ def cwd_relative_nodeid(self, nodeid):
+ # nodeid's are relative to the rootpath, compute relative to cwd
+ if self.invocation_dir != self.rootdir:
+ fullpath = self.rootdir.join(nodeid)
+ nodeid = self.invocation_dir.bestrelpath(fullpath)
+ return nodeid
@classmethod
def fromdictargs(cls, option_dict, args):
@@ -691,14 +697,9 @@
def _initini(self, args):
parsed_args = self._parser.parse_known_args(args)
- if parsed_args.inifilename:
- iniconfig = py.iniconfig.IniConfig(parsed_args.inifilename)
- if 'pytest' in iniconfig.sections:
- self.inicfg = iniconfig['pytest']
- else:
- self.inicfg = {}
- else:
- self.inicfg = getcfg(args, ["pytest.ini", "tox.ini", "setup.cfg"])
+ r = determine_setup(parsed_args.inifilename, parsed_args.file_or_dir)
+ self.rootdir, self.inifile, self.inicfg = r
+ self.invocation_dir = py.path.local()
self._parser.addini('addopts', 'extra command line options', 'args')
self._parser.addini('minversion', 'minimally required pytest version')
@@ -859,8 +860,58 @@
if exists(p):
iniconfig = py.iniconfig.IniConfig(p)
if 'pytest' in iniconfig.sections:
- return iniconfig['pytest']
- return {}
+ return base, p, iniconfig['pytest']
+ elif inibasename == "pytest.ini":
+ # allowed to be empty
+ return base, p, {}
+ return None, None, None
+
+
+def get_common_ancestor(args):
+ # args are what we get after early command line parsing (usually
+ # strings, but can be py.path.local objects as well)
+ common_ancestor = None
+ for arg in args:
+ if str(arg)[0] == "-":
+ continue
+ p = py.path.local(arg)
+ if common_ancestor is None:
+ common_ancestor = p
+ else:
+ if p.relto(common_ancestor) or p == common_ancestor:
+ continue
+ elif common_ancestor.relto(p):
+ common_ancestor = p
+ else:
+ shared = p.common(common_ancestor)
+ if shared is not None:
+ common_ancestor = shared
+ if common_ancestor is None:
+ common_ancestor = py.path.local()
+ elif not common_ancestor.isdir():
+ common_ancestor = common_ancestor.dirpath()
+ return common_ancestor
+
+
+def determine_setup(inifile, args):
+ if inifile:
+ iniconfig = py.iniconfig.IniConfig(inifile)
+ try:
+ inicfg = iniconfig["pytest"]
+ except KeyError:
+ inicfg = None
+ rootdir = get_common_ancestor(args)
+ else:
+ ancestor = get_common_ancestor(args)
+ rootdir, inifile, inicfg = getcfg(
+ [ancestor], ["pytest.ini", "tox.ini", "setup.cfg"])
+ if rootdir is None:
+ for rootdir in ancestor.parts(reverse=True):
+ if rootdir.join("setup.py").exists():
+ break
+ else:
+ rootdir = ancestor
+ return rootdir, inifile, inicfg or {}
def setns(obj, dic):
diff -r f7f076b07d105d2fceeb38c998910be33f9fe290 -r
9c7946ebb69c7d4c778e5e6c46e026ca715ae18d _pytest/main.py
--- a/_pytest/main.py
+++ b/_pytest/main.py
@@ -457,9 +457,7 @@
self.fspath = fspath
def _makeid(self):
- if self == self.session:
- return "."
- relpath = self.session.fspath.bestrelpath(self.fspath)
+ relpath = self.fspath.relto(self.config.rootdir)
if os.sep != "/":
relpath = relpath.replace(os.sep, "/")
return relpath
@@ -510,7 +508,7 @@
__module__ = 'builtins' # for py3
def __init__(self, config):
- FSCollector.__init__(self, py.path.local(), parent=None,
+ FSCollector.__init__(self, config.rootdir, parent=None,
config=config, session=self)
self.config.pluginmanager.register(self, name="session", prepend=True)
self._testsfailed = 0
@@ -520,6 +518,9 @@
self.startdir = py.path.local()
self._fs2hookproxy = {}
+ def _makeid(self):
+ return ""
+
def pytest_collectstart(self):
if self.shouldstop:
raise self.Interrupted(self.shouldstop)
@@ -663,7 +664,7 @@
arg = self._tryconvertpyarg(arg)
parts = str(arg).split("::")
relpath = parts[0].replace("/", os.sep)
- path = self.fspath.join(relpath, abs=True)
+ path = self.config.invocation_dir.join(relpath, abs=True)
if not path.check():
if self.config.option.pyargs:
msg = "file or package not found: "
diff -r f7f076b07d105d2fceeb38c998910be33f9fe290 -r
9c7946ebb69c7d4c778e5e6c46e026ca715ae18d _pytest/pytester.py
--- a/_pytest/pytester.py
+++ b/_pytest/pytester.py
@@ -306,9 +306,8 @@
session = Session(config)
assert '::' not in str(arg)
p = py.path.local(arg)
- x = session.fspath.bestrelpath(p)
config.hook.pytest_sessionstart(session=session)
- res = session.perform_collect([x], genitems=False)[0]
+ res = session.perform_collect([str(p)], genitems=False)[0]
config.hook.pytest_sessionfinish(session=session, exitstatus=EXIT_OK)
return res
@@ -395,8 +394,7 @@
def parseconfigure(self, *args):
config = self.parseconfig(*args)
config.do_configure()
- self.request.addfinalizer(lambda:
- config.do_unconfigure())
+ self.request.addfinalizer(config.do_unconfigure)
return config
def getitem(self, source, funcname="test_func"):
diff -r f7f076b07d105d2fceeb38c998910be33f9fe290 -r
9c7946ebb69c7d4c778e5e6c46e026ca715ae18d _pytest/python.py
--- a/_pytest/python.py
+++ b/_pytest/python.py
@@ -1653,11 +1653,9 @@
# what fixtures are visible for particular tests (as denoted
# by their test id)
if p.basename.startswith("conftest.py"):
- nodeid = self.session.fspath.bestrelpath(p.dirpath())
+ nodeid = p.dirpath().relto(self.config.rootdir)
if p.sep != "/":
nodeid = nodeid.replace(p.sep, "/")
- if nodeid == ".":
- nodeid = ""
self.parsefactories(plugin, nodeid)
self._seenplugins.add(plugin)
diff -r f7f076b07d105d2fceeb38c998910be33f9fe290 -r
9c7946ebb69c7d4c778e5e6c46e026ca715ae18d _pytest/skipping.py
--- a/_pytest/skipping.py
+++ b/_pytest/skipping.py
@@ -218,14 +218,14 @@
failed = terminalreporter.stats.get(stat)
if failed:
for rep in failed:
- pos = rep.nodeid
- lines.append(format %(pos, ))
+ pos = terminalreporter.config.cwd_relative_nodeid(rep.nodeid)
+ lines.append(format %(pos,))
def show_xfailed(terminalreporter, lines):
xfailed = terminalreporter.stats.get("xfailed")
if xfailed:
for rep in xfailed:
- pos = rep.nodeid
+ pos = terminalreporter.config.cwd_relative_nodeid(rep.nodeid)
reason = rep.wasxfail
lines.append("XFAIL %s" % (pos,))
if reason:
@@ -235,7 +235,7 @@
xpassed = terminalreporter.stats.get("xpassed")
if xpassed:
for rep in xpassed:
- pos = rep.nodeid
+ pos = terminalreporter.config.cwd_relative_nodeid(rep.nodeid)
reason = rep.wasxfail
lines.append("XPASS %s %s" %(pos, reason))
diff -r f7f076b07d105d2fceeb38c998910be33f9fe290 -r
9c7946ebb69c7d4c778e5e6c46e026ca715ae18d _pytest/terminal.py
--- a/_pytest/terminal.py
+++ b/_pytest/terminal.py
@@ -95,7 +95,7 @@
self._numcollected = 0
self.stats = {}
- self.startdir = self.curdir = py.path.local()
+ self.startdir = py.path.local()
if file is None:
file = sys.stdout
self._tw = self.writer = py.io.TerminalWriter(file)
@@ -111,12 +111,12 @@
char = {'xfailed': 'x', 'skipped': 's'}.get(char, char)
return char in self.reportchars
- def write_fspath_result(self, fspath, res):
+ def write_fspath_result(self, nodeid, res):
+ fspath = self.config.rootdir.join(nodeid.split("::")[0])
if fspath != self.currentfspath:
self.currentfspath = fspath
- #fspath = self.startdir.bestrelpath(fspath)
+ fspath = self.startdir.bestrelpath(fspath)
self._tw.line()
- #relpath = self.startdir.bestrelpath(fspath)
self._tw.write(fspath + " ")
self._tw.write(res)
@@ -182,12 +182,12 @@
def pytest_runtest_logstart(self, nodeid, location):
# ensure that the path is printed before the
# 1st test of a module starts running
- fspath = nodeid.split("::")[0]
if self.showlongtestinfo:
- line = self._locationline(fspath, *location)
+ line = self._locationline(nodeid, *location)
self.write_ensure_prefix(line, "")
elif self.showfspath:
- self.write_fspath_result(fspath, "")
+ fsid = nodeid.split("::")[0]
+ self.write_fspath_result(fsid, "")
def pytest_runtest_logreport(self, report):
rep = report
@@ -200,7 +200,7 @@
return
if self.verbosity <= 0:
if not hasattr(rep, 'node') and self.showfspath:
- self.write_fspath_result(rep.fspath, letter)
+ self.write_fspath_result(rep.nodeid, letter)
else:
self._tw.write(letter)
else:
@@ -213,7 +213,7 @@
markup = {'red':True}
elif rep.skipped:
markup = {'yellow':True}
- line = self._locationline(str(rep.fspath), *rep.location)
+ line = self._locationline(rep.nodeid, *rep.location)
if not hasattr(rep, 'node'):
self.write_ensure_prefix(line, word, **markup)
#self._tw.write(word, **markup)
@@ -237,7 +237,7 @@
items = [x for x in report.result if isinstance(x, pytest.Item)]
self._numcollected += len(items)
if self.hasmarkup:
- #self.write_fspath_result(report.fspath, 'E')
+ #self.write_fspath_result(report.nodeid, 'E')
self.report_collect()
def report_collect(self, final=False):
@@ -288,6 +288,10 @@
self.write_line(line)
def pytest_report_header(self, config):
+ inifile = ""
+ if config.inifile:
+ inifile = config.rootdir.bestrelpath(config.inifile)
+ lines = ["rootdir: %s, inifile: %s" %(config.rootdir, inifile)]
plugininfo = config.pluginmanager._plugin_distinfo
if plugininfo:
l = []
@@ -296,7 +300,8 @@
if name.startswith("pytest-"):
name = name[7:]
l.append(name)
- return "plugins: %s" % ", ".join(l)
+ lines.append("plugins: %s" % ", ".join(l))
+ return lines
def pytest_collection_finish(self, session):
if self.config.option.collectonly:
@@ -378,19 +383,24 @@
else:
excrepr.reprcrash.toterminal(self._tw)
- def _locationline(self, collect_fspath, fspath, lineno, domain):
+ def _locationline(self, nodeid, fspath, lineno, domain):
+ def mkrel(nodeid):
+ line = self.config.cwd_relative_nodeid(nodeid)
+ if domain and line.endswith(domain):
+ line = line[:-len(domain)]
+ l = domain.split("[")
+ l[0] = l[0].replace('.', '::') # don't replace '.' in params
+ line += "[".join(l)
+ return line
# collect_fspath comes from testid which has a "/"-normalized path
- if fspath and fspath.replace("\\", "/") != collect_fspath:
- fspath = "%s <- %s" % (collect_fspath, fspath)
+
if fspath:
- line = str(fspath)
- if domain:
- split = str(domain).split('[')
- split[0] = split[0].replace('.', '::') # don't replace '.' in
params
- line += "::" + '['.join(split)
+ res = mkrel(nodeid).replace("::()", "") # parens-normalization
+ if nodeid.split("::")[0] != fspath.replace("\\", "/"):
+ res += " <- " + self.startdir.bestrelpath(fspath)
else:
- line = "[location]"
- return line + " "
+ res = "[location]"
+ return res + " "
def _getfailureheadline(self, rep):
if hasattr(rep, 'location'):
diff -r f7f076b07d105d2fceeb38c998910be33f9fe290 -r
9c7946ebb69c7d4c778e5e6c46e026ca715ae18d doc/en/customize.txt
--- a/doc/en/customize.txt
+++ b/doc/en/customize.txt
@@ -12,37 +12,73 @@
This will display command line and configuration file settings
which were registered by installed plugins.
+.. _rootdir:
.. _inifiles:
-How test configuration is read from configuration INI-files
--------------------------------------------------------------
+initialization: determining rootdir and inifile
+-----------------------------------------------
-``pytest`` searches for the first matching ini-style configuration file
-in the directories of command line argument and the directories above.
-It looks for file basenames in this order::
+.. versionadded:: 2.7
+pytest determines a "rootdir" for each test run which depends on
+the command line arguments (specified test files, paths) and on
+the existence of inifiles. The determined rootdir and ini-file are
+printed as part of the pytest header. The rootdir is used for constructing
+"nodeids" during collection and may also be used by plugins to store
+project/testrun-specific information.
+
+Here is the algorithm which finds the rootdir from ``args``:
+
+- determine the common ancestor directory for the specified ``args``.
+
+- look for ``pytest.ini``, ``tox.ini`` and ``setup.cfg`` files in the
+ ancestor directory and upwards. If one is matched, it becomes the
+ ini-file and its directory becomes the rootdir. An existing
+ ``pytest.ini`` file will always be considered a match whereas
+ ``tox.ini`` and ``setup.cfg`` will only match if they contain
+ a ``[pytest]`` section.
+
+- if no ini-file was found, look for ``setup.py`` upwards from
+ the common ancestor directory to determine the ``rootdir``.
+
+- if no ini-file and no ``setup.py`` was found, use the already
+ determined common ancestor as root directory. This allows to
+ work with pytest in structures that are not part of a package
+ and don't have any particular ini-file configuration.
+
+Note that options from multiple ini-files candidates are never merged,
+the first one wins (``pytest.ini`` always wins even if it does not
+contain a ``[pytest]`` section).
+
+The ``config`` object will subsequently carry these attributes:
+
+- ``config.rootdir``: the determined root directory, guaranteed to exist.
+
+- ``config.inifile``: the determined ini-file, may be ``None``.
+
+The rootdir is used a reference directory for constructing test
+addresses ("nodeids") and can be used also by plugins for storing
+per-testrun information.
+
+Example::
+
+ py.test path/to/testdir path/other/
+
+will determine the common ancestor as ``path`` and then
+check for ini-files as follows::
+
+ # first look for pytest.ini files
+ path/pytest.ini
+ path/setup.cfg # must also contain [pytest] section to match
+ path/tox.ini # must also contain [pytest] section to match
pytest.ini
- tox.ini
- setup.cfg
+ ... # all the way down to the root
-Searching stops when the first ``[pytest]`` section is found in any of
-these files. There is no merging of configuration values from multiple
-files. Example::
+ # now look for setup.py
+ path/setup.py
+ setup.py
+ ... # all the way down to the root
- py.test path/to/testdir
-
-will look in the following dirs for a config file::
-
- path/to/testdir/pytest.ini
- path/to/testdir/tox.ini
- path/to/testdir/setup.cfg
- path/to/pytest.ini
- path/to/tox.ini
- path/to/setup.cfg
- ... # up until root of filesystem
-
-If argument is provided to a ``pytest`` run, the current working directory
-is used to start the search.
.. _`how to change command line options defaults`:
.. _`adding default options`:
@@ -67,6 +103,8 @@
From now on, running ``pytest`` will add the specified options.
+
+
Builtin configuration file options
----------------------------------------------
diff -r f7f076b07d105d2fceeb38c998910be33f9fe290 -r
9c7946ebb69c7d4c778e5e6c46e026ca715ae18d testing/test_collection.py
--- a/testing/test_collection.py
+++ b/testing/test_collection.py
@@ -343,7 +343,7 @@
("pytest_make_collect_report", "collector.fspath == p"),
("pytest_pycollect_makeitem", "name == 'test_func'"),
("pytest_collectreport", "report.nodeid.startswith(p.basename)"),
- ("pytest_collectreport", "report.nodeid == '.'")
+ ("pytest_collectreport", "report.nodeid == ''")
])
def test_collect_protocol_method(self, testdir):
@@ -478,7 +478,7 @@
config = testdir.parseconfigure(x)
col = testdir.getnode(config, x)
assert isinstance(col, pytest.Module)
- assert col.name == 'subdir/x.py'
+ assert col.name == 'x.py'
assert col.parent.parent is None
for col in col.listchain():
assert col.config is config
diff -r f7f076b07d105d2fceeb38c998910be33f9fe290 -r
9c7946ebb69c7d4c778e5e6c46e026ca715ae18d testing/test_config.py
--- a/testing/test_config.py
+++ b/testing/test_config.py
@@ -1,6 +1,6 @@
import py, pytest
-from _pytest.config import getcfg
+from _pytest.config import getcfg, get_common_ancestor, determine_setup
class TestParseIni:
def test_getcfg_and_config(self, testdir, tmpdir):
@@ -10,7 +10,7 @@
[pytest]
name = value
"""))
- cfg = getcfg([sub], ["setup.cfg"])
+ rootdir, inifile, cfg = getcfg([sub], ["setup.cfg"])
assert cfg['name'] == "value"
config = testdir.parseconfigure(sub)
assert config.inicfg['name'] == 'value'
@@ -400,3 +400,55 @@
*WT1*test_warn_on_test_item*:5*hello*
*1 warning*
""")
+
+class TestRootdir:
+ def test_simple_noini(self, tmpdir):
+ assert get_common_ancestor([tmpdir]) == tmpdir
+ assert get_common_ancestor([tmpdir.mkdir("a"), tmpdir]) == tmpdir
+ assert get_common_ancestor([tmpdir, tmpdir.join("a")]) == tmpdir
+ with tmpdir.as_cwd():
+ assert get_common_ancestor([]) == tmpdir
+
+ @pytest.mark.parametrize("name", "setup.cfg tox.ini pytest.ini".split())
+ def test_with_ini(self, tmpdir, name):
+ inifile = tmpdir.join(name)
+ inifile.write("[pytest]\n")
+
+ a = tmpdir.mkdir("a")
+ b = a.mkdir("b")
+ for args in ([tmpdir], [a], [b]):
+ rootdir, inifile, inicfg = determine_setup(None, args)
+ assert rootdir == tmpdir
+ assert inifile == inifile
+ rootdir, inifile, inicfg = determine_setup(None, [b,a])
+ assert rootdir == tmpdir
+ assert inifile == inifile
+
+ @pytest.mark.parametrize("name", "setup.cfg tox.ini".split())
+ def test_pytestini_overides_empty_other(self, tmpdir, name):
+ inifile = tmpdir.ensure("pytest.ini")
+ a = tmpdir.mkdir("a")
+ a.ensure(name)
+ rootdir, inifile, inicfg = determine_setup(None, [a])
+ assert rootdir == tmpdir
+ assert inifile == inifile
+
+ def test_setuppy_fallback(self, tmpdir):
+ a = tmpdir.mkdir("a")
+ a.ensure("setup.cfg")
+ tmpdir.ensure("setup.py")
+ rootdir, inifile, inicfg = determine_setup(None, [a])
+ assert rootdir == tmpdir
+ assert inifile is None
+ assert inicfg == {}
+
+ def test_nothing(self, tmpdir):
+ rootdir, inifile, inicfg = determine_setup(None, [tmpdir])
+ assert rootdir == tmpdir
+ assert inifile is None
+ assert inicfg == {}
+
+ def test_with_specific_inifile(self, tmpdir):
+ inifile = tmpdir.ensure("pytest.ini")
+ rootdir, inifile, inicfg = determine_setup(inifile, [tmpdir])
+ assert rootdir == tmpdir
diff -r f7f076b07d105d2fceeb38c998910be33f9fe290 -r
9c7946ebb69c7d4c778e5e6c46e026ca715ae18d testing/test_conftest.py
--- a/testing/test_conftest.py
+++ b/testing/test_conftest.py
@@ -1,7 +1,9 @@
+from textwrap import dedent
import py, pytest
from _pytest.config import Conftest
+
@pytest.fixture(scope="module", params=["global", "inpackage"])
def basedir(request):
from _pytest.tmpdir import tmpdir
@@ -255,3 +257,89 @@
result.stdout.fnmatch_lines("""
*--hello-world*
""")
+
+
+class TestConftestVisibility:
+ def _setup_tree(self, testdir): # for issue616
+ # example mostly taken from:
+ #
https://mail.python.org/pipermail/pytest-dev/2014-September/002617.html
+ runner = testdir.mkdir("empty")
+ package = testdir.mkdir("package")
+
+ package.join("conftest.py").write(dedent("""\
+ import pytest
+ @pytest.fixture
+ def fxtr():
+ return "from-package"
+ """))
+ package.join("test_pkgroot.py").write(dedent("""\
+ def test_pkgroot(fxtr):
+ assert fxtr == "from-package"
+ """))
+
+ swc = package.mkdir("swc")
+ swc.join("__init__.py").ensure()
+ swc.join("conftest.py").write(dedent("""\
+ import pytest
+ @pytest.fixture
+ def fxtr():
+ return "from-swc"
+ """))
+ swc.join("test_with_conftest.py").write(dedent("""\
+ def test_with_conftest(fxtr):
+ assert fxtr == "from-swc"
+
+ """))
+
+ snc = package.mkdir("snc")
+ snc.join("__init__.py").ensure()
+ snc.join("test_no_conftest.py").write(dedent("""\
+ def test_no_conftest(fxtr):
+ assert fxtr == "from-package" # No local conftest.py, so
should
+ # use value from parent dir's
+
+ """))
+ print ("created directory structure:")
+ for x in testdir.tmpdir.visit():
+ print (" " + x.relto(testdir.tmpdir))
+
+ return {
+ "runner": runner,
+ "package": package,
+ "swc": swc,
+ "snc": snc}
+
+ # N.B.: "swc" stands for "subdir with conftest.py"
+ # "snc" stands for "subdir no [i.e. without] conftest.py"
+ @pytest.mark.parametrize("chdir,testarg,expect_ntests_passed", [
+ ("runner", "..", 3),
+ ("package", "..", 3),
+ ("swc", "../..", 3),
+ ("snc", "../..", 3),
+
+ ("runner", "../package", 3),
+ ("package", ".", 3),
+ ("swc", "..", 3),
+ ("snc", "..", 3),
+
+ ("runner", "../package/swc", 1),
+ ("package", "./swc", 1),
+ ("swc", ".", 1),
+ ("snc", "../swc", 1),
+
+ ("runner", "../package/snc", 1),
+ ("package", "./snc", 1),
+ ("swc", "../snc", 1),
+ ("snc", ".", 1),
+ ])
+ @pytest.mark.issue616
+ def test_parsefactories_relative_node_ids(
+ self, testdir, chdir,testarg, expect_ntests_passed):
+ dirs = self._setup_tree(testdir)
+ print("pytest run in cwd: %s" %(
+ dirs[chdir].relto(testdir.tmpdir)))
+ print("pytestarg : %s" %(testarg))
+ print("expected pass : %s" %(expect_ntests_passed))
+ with dirs[chdir].as_cwd():
+ reprec = testdir.inline_run(testarg, "-q", "--traceconfig")
+ reprec.assertoutcome(passed=expect_ntests_passed)
diff -r f7f076b07d105d2fceeb38c998910be33f9fe290 -r
9c7946ebb69c7d4c778e5e6c46e026ca715ae18d testing/test_doctest.py
--- a/testing/test_doctest.py
+++ b/testing/test_doctest.py
@@ -1,9 +1,6 @@
from _pytest.doctest import DoctestItem, DoctestModule, DoctestTextfile
import py, pytest
-import pdb
-
-
class TestDoctests:
def test_collect_testtextfile(self, testdir):
diff -r f7f076b07d105d2fceeb38c998910be33f9fe290 -r
9c7946ebb69c7d4c778e5e6c46e026ca715ae18d testing/test_terminal.py
--- a/testing/test_terminal.py
+++ b/testing/test_terminal.py
@@ -77,11 +77,11 @@
def test_writeline(self, testdir, linecomp):
modcol = testdir.getmodulecol("def test_one(): pass")
rep = TerminalReporter(modcol.config, file=linecomp.stringio)
- rep.write_fspath_result(py.path.local("xy.py"), '.')
+ rep.write_fspath_result(modcol.nodeid, ".")
rep.write_line("hello world")
lines = linecomp.stringio.getvalue().split('\n')
assert not lines[0]
- assert lines[1].endswith("xy.py .")
+ assert lines[1].endswith(modcol.name + " .")
assert lines[2] == "hello world"
def test_show_runtest_logstart(self, testdir, linecomp):
@@ -126,7 +126,7 @@
])
result = testdir.runpytest("-v", p2)
result.stdout.fnmatch_lines([
- "*test_p2.py <- *test_p1.py::TestMore::test_p1*",
+ "*test_p2.py::TestMore::test_p1* <- *test_p1.py*PASSED",
])
def test_itemreport_directclasses_not_shown_as_subclasses(self, testdir):
Repository URL: https://bitbucket.org/pytest-dev/pytest/
--
This is a commit notification from bitbucket.org. You are receiving
this because you have the service enabled, addressing the recipient of
this email.
_______________________________________________
pytest-commit mailing list
[email protected]
https://mail.python.org/mailman/listinfo/pytest-commit