Hello everyone, I'm trying to concatenate two smiles to get the product of some reactions. In general, it is mostly clear where the bond is formed. An example:
Nucleophile: O=C1CCC(=O)[N-]1 Substrate: C1=C2CCCN3CCC(=C23)C=C1[CH+]C1=CC2=C3C(=C1)CCCN3CC2 I want to rearrange the smiles always under some conditions. In this example depending on where the charge is located respectively. So the bond is formed between the [N-] and the [CH+] atoms. Can someone help me out with this? Best regards, Markus
_______________________________________________ Rdkit-discuss mailing list [email protected] https://lists.sourceforge.net/lists/listinfo/rdkit-discuss

