Dear Quoc-Tuan,
On 04/05/2020 09:10, Greenpharma S.A.S. wrote:
Dear All,
Please could you help with the following problem (I could not find
answers in discussion list) ?
pattern='C~C~C(~C)~C'
smiles='O[C@H]1C[C@H]2C([C@@]1(C)CC2)(C)C'
pat = Chem.MolFromSmiles(pattern)
mol = Chem.MolFromSmiles(smiles)
res = mol.GetSubstructMatches(pat, uniquify=True)
The results are:
((1, 2, 3, 4, 8), (1, 5, 4, 3, 9), (1, 5, 4, 3, 10), (1, 5, 4, 9, 10),
(2, 1, 5, 4, 6), (2, 1, 5, 4, 7), (2, 1, 5, 6, 7), (2, 3, 4, 5, 9),
(2, 3, 4, 5, 10), (2, 3, 4, 9, 10), (3, 4, 5, 1, 6), (3, 4, 5, 1, 7),
(3, 4, 5, 6, 7), (5, 4, 3, 2, 8), (6, 5, 4, 3, 9), (6, 5, 4, 3, 10),
(6, 5, 4, 9, 10), (7, 5, 4, 3, 9), (7, 5, 4, 3, 10), (7, 5, 4, 9, 10),
(7, 8, 3, 2, 4), (8, 3, 4, 5, 9), (8, 3, 4, 5, 10), (8, 3, 4, 9, 10),
(8, 7, 5, 1, 4), (8, 7, 5, 1, 6), (8, 7, 5, 4, 6), (9, 4, 3, 2, 8),
(9, 4, 5, 1, 6), (9, 4, 5, 1, 7), (9, 4, 5, 6, 7), (10, 4, 3, 2, 8),
(10, 4, 5, 1, 6), (10, 4, 5, 1, 7), (10, 4, 5, 6, 7))
I expect to have only 2 matches with uniquify=True as I only have 2
units of the pattern.
GetSubstructMatches() will report all matches of the pattern against
your molecule. In your case, there are 35 matches which are all
constituted by different atom indices.
Furthermore, with or without uniquify, I have the same answers.
If you set uniquify=False, you actually get 70 matches, so twice as many
answers. This time, matches can be constitued by the same indices,
provided they are in a different permutation.
I have uploaded a gist here:
https://gist.github.com/ptosco/6d70cec235361fbaddc7cbc2cf9c3b5d
that hopefully will make this clearer.
Cheers,
p.
I also expected that there should be 2 "independent" lists but here,
there is always at least one common atom between each list.
Is there something misunderstood or misused?
Thanks in advance for your help and explanations.
Best regards,
Quoc-Tuan
_______________________________________________
Rdkit-discuss mailing list
[email protected]
https://lists.sourceforge.net/lists/listinfo/rdkit-discuss
_______________________________________________
Rdkit-discuss mailing list
[email protected]
https://lists.sourceforge.net/lists/listinfo/rdkit-discuss