I've been trying to use the RunReactants portion of the ChemicalReaction enumeration with chiral reagents, and a chiral reaction, but I don't seem to get chiral products out.
For example, using a template reaction: C[C@@H](Oc1cccc(C(=O)O)c1)c1ccccc1.[NH3:1]>>C[C@ @H](Oc1cccc(C(=O)[NH2:1])c1)c1ccccc1 [image: image.png] Reactant 1: C[C@@H](OC1=CC(C(=O)O)=CC=C1)C1=CC=CC=C1 [image: image.png] Reactant 2: NC1(CO)CC(F)(F)C1 [image: image.png] Product: CC(Oc1cccc(C(=O)NC2(CO)CC(F)(F)C2)c1)c1ccccc1 [image: image.png] Not that the methyl at the top of the drawing no longer has an R indication. Is there anything inherent to the RunReactants function that clears chirality, as it appears to be retained right up until the combination step to generate the product?
_______________________________________________ Rdkit-discuss mailing list [email protected] https://lists.sourceforge.net/lists/listinfo/rdkit-discuss

