http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/compressible/node_modules/mime-db/index.js ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/compressible/node_modules/mime-db/index.js b/node_modules/cordova-serve/node_modules/compression/node_modules/compressible/node_modules/mime-db/index.js new file mode 100644 index 0000000..551031f --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/compressible/node_modules/mime-db/index.js @@ -0,0 +1,11 @@ +/*! + * mime-db + * Copyright(c) 2014 Jonathan Ong + * MIT Licensed + */ + +/** + * Module exports. + */ + +module.exports = require('./db.json')
http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/compressible/node_modules/mime-db/package.json ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/compressible/node_modules/mime-db/package.json b/node_modules/cordova-serve/node_modules/compression/node_modules/compressible/node_modules/mime-db/package.json new file mode 100644 index 0000000..9e10cd5 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/compressible/node_modules/mime-db/package.json @@ -0,0 +1,74 @@ +{ + "name": "mime-db", + "description": "Media Type Database", + "version": "1.19.0", + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "d...@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "m...@jongleberry.com", + "url": "http://jongleberry.com" + }, + { + "name": "Robert Kieffer", + "email": "rob...@broofa.com", + "url": "http://github.com/broofa" + } + ], + "license": "MIT", + "keywords": [ + "mime", + "db", + "type", + "types", + "database", + "charset", + "charsets" + ], + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/mime-db.git" + }, + "devDependencies": { + "bluebird": "2.10.0", + "co": "4.6.0", + "cogent": "1.0.1", + "csv-parse": "1.0.0", + "gnode": "0.1.1", + "istanbul": "0.3.20", + "mocha": "1.21.5", + "raw-body": "2.1.3", + "stream-to-array": "2" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "db.json", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "build": "node scripts/build", + "fetch": "gnode scripts/fetch-apache && gnode scripts/fetch-iana && gnode scripts/fetch-nginx", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "update": "npm run fetch && npm run build" + }, + "readme": "# mime-db\n\n[![NPM Version][npm-version-image]][npm-url]\n[![NPM Downloads][npm-downloads-image]][npm-url]\n[![Node.js Version][node-image]][node-url]\n[![Build Status][travis-image]][travis-url]\n[![Coverage Status][coveralls-image]][coveralls-url]\n\nThis is a database of all mime types.\nIt consists of a single, public JSON file and does not include any logic,\nallowing it to remain as un-opinionated as possible with an API.\nIt aggregates data from the following sources:\n\n- http://www.iana.org/assignments/media-types/media-types.xhtml\n- http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types\n- http://hg.nginx.org/nginx/raw-file/default/conf/mime.types\n\n## Installation\n\n```bash\nnpm install mime-db\n```\n\n### Database Download\n\nIf you're crazy enough to use this in the browser, you can just grab the\nJSON file using [RawGit](https://rawgit.com/). It is recommended to replace\n`master` with [a release tag](https://github.com/jshttp/mime-db/t ags) as the\nJSON format may change in the future.\n\n```\nhttps://cdn.rawgit.com/jshttp/mime-db/master/db.json\n```\n\n## Usage\n\n```js\nvar db = require('mime-db');\n\n// grab data on .js files\nvar data = db['application/javascript'];\n```\n\n## Data Structure\n\nThe JSON file is a map lookup for lowercased mime types.\nEach mime type has the following properties:\n\n- `.source` - where the mime type is defined.\n If not set, it's probably a custom media type.\n - `apache` - [Apache common media types](http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types)\n - `iana` - [IANA-defined media types](http://www.iana.org/assignments/media-types/media-types.xhtml)\n - `nginx` - [nginx media types](http://hg.nginx.org/nginx/raw-file/default/conf/mime.types)\n- `.extensions[]` - known extensions associated with this mime type.\n- `.compressible` - whether a file of this type is can be gzipped.\n- `.charset` - the default charset associated with this type, if any.\n\nIf unknown, every property could be `undefined`.\n\n## Contributing\n\nTo edit the database, only make PRs against `src/custom.json` or\n`src/custom-suffix.json`.\n\nTo update the build, run `npm run build`.\n\n## Adding Custom Media Types\n\nThe best way to get new media types included in this library is to register\nthem with the IANA. The community registration procedure is outlined in\n[RFC 6838 section 5](http://tools.ietf.org/html/rfc6838#section-5). Types\nregistered with the IANA are automatically pulled into this library.\n\n[npm-version-image]: https://img.shields.io/npm/v/mime-db.svg\n[npm-downloads-image]: https://img.shields.io/npm/dm/mime-db.svg\n[npm-url]: https://npmjs.org/package/mime-db\n[travis-image]: https://img.shields.io/travis/jshttp/mime-db/master.svg\n[travis-url]: https://travis-ci.org/jshttp/mime-db\n[coveralls-image]: https://img.shields.io/coveralls/jshttp/mime-db/master.svg\n[coveralls-url]: https://coveralls.io/r/jshttp/mime-db?branch=master\n [node-image]: https://img.shields.io/node/v/mime-db.svg\n[node-url]: http://nodejs.org/download/\n", + "readmeFilename": "README.md", + "bugs": { + "url": "https://github.com/jshttp/mime-db/issues" + }, + "homepage": "https://github.com/jshttp/mime-db#readme", + "_id": "mime-db@1.19.0", + "_shasum": "496a18198a7ce8244534e25bb102b74fb420fd56", + "_resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.19.0.tgz", + "_from": "mime-db@>=1.19.0 <2.0.0" +} http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/compressible/package.json ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/compressible/package.json b/node_modules/cordova-serve/node_modules/compression/node_modules/compressible/package.json new file mode 100644 index 0000000..38a28c2 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/compressible/package.json @@ -0,0 +1,59 @@ +{ + "name": "compressible", + "description": "Compressible Content-Type / mime checking", + "version": "2.0.6", + "contributors": [ + { + "name": "Jonathan Ong", + "email": "m...@jongleberry.com", + "url": "http://jongleberry.com" + }, + { + "name": "Jeremiah Senkpiel", + "email": "fishrock...@rocketmail.com", + "url": "https://searchbeam.jit.su" + } + ], + "license": "MIT", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/compressible.git" + }, + "keywords": [ + "compress", + "gzip", + "mime", + "content-type" + ], + "dependencies": { + "mime-db": ">= 1.19.0 < 2" + }, + "devDependencies": { + "istanbul": "0.3.21", + "mocha": "~1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot --check-leaks" + }, + "readme": "# compressible\n\n[![NPM Version][npm-image]][npm-url]\n[![NPM Downloads][downloads-image]][downloads-url]\n[![Node.js Version][node-version-image]][node-version-url]\n[![Build Status][travis-image]][travis-url]\n[![Test Coverage][coveralls-image]][coveralls-url]\n\nCompressible `Content-Type` / `mime` checking.\n\n### Installation\n\n```bash\n$ npm install compressible\n```\n\n## API\n\n### compressible(type)\n\nChecks if the given content-type is compressible.\n\n```js\nvar compressible = require('compressible')\n\ncompressible('text/html') // => true\ncompressible('image/png') // => false\n```\n\n## [MIT Licensed](LICENSE)\n\n[npm-image]: https://img.shields.io/npm/v/compressible.svg\n[npm-url]: https://npmjs.org/package/compressible\n[node-version-image]: https://img.shields.io/node/v/compressible.svg\n[node-version-url]: http://nodejs.org/download/\n[travis-image]: https://img.shields.io/travis/jshttp/compressible/master.svg\n[travis-url]: https://travis-ci.org/jsh ttp/compressible\n[coveralls-image]: https://img.shields.io/coveralls/jshttp/compressible/master.svg\n[coveralls-url]: https://coveralls.io/r/jshttp/compressible?branch=master\n[downloads-image]: https://img.shields.io/npm/dm/compressible.svg\n[downloads-url]: https://npmjs.org/package/compressible\n", + "readmeFilename": "README.md", + "bugs": { + "url": "https://github.com/jshttp/compressible/issues" + }, + "homepage": "https://github.com/jshttp/compressible#readme", + "_id": "compressible@2.0.6", + "_shasum": "9e4aa9321ffcf9cc4d81954f7aafa9f35767d5ea", + "_resolved": "https://registry.npmjs.org/compressible/-/compressible-2.0.6.tgz", + "_from": "compressible@>=2.0.6 <2.1.0" +} http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/debug/.jshintrc ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/debug/.jshintrc b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/.jshintrc new file mode 100644 index 0000000..299877f --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/.jshintrc @@ -0,0 +1,3 @@ +{ + "laxbreak": true +} http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/debug/.npmignore ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/debug/.npmignore b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/.npmignore new file mode 100644 index 0000000..7e6163d --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/.npmignore @@ -0,0 +1,6 @@ +support +test +examples +example +*.sock +dist http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/debug/History.md ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/debug/History.md b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/History.md new file mode 100644 index 0000000..854c971 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/History.md @@ -0,0 +1,195 @@ + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/debug/Makefile ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/debug/Makefile b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/Makefile new file mode 100644 index 0000000..5cf4a59 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/Makefile @@ -0,0 +1,36 @@ + +# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 +THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) +THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) + +# BIN directory +BIN := $(THIS_DIR)/node_modules/.bin + +# applications +NODE ?= $(shell which node) +NPM ?= $(NODE) $(shell which npm) +BROWSERIFY ?= $(NODE) $(BIN)/browserify + +all: dist/debug.js + +install: node_modules + +clean: + @rm -rf dist + +dist: + @mkdir -p $@ + +dist/debug.js: node_modules browser.js debug.js dist + @$(BROWSERIFY) \ + --standalone debug \ + . > $@ + +distclean: clean + @rm -rf node_modules + +node_modules: package.json + @NODE_ENV= $(NPM) install + @touch node_modules + +.PHONY: all install clean distclean http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/debug/Readme.md ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/debug/Readme.md b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/Readme.md new file mode 100644 index 0000000..b4f45e3 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/Readme.md @@ -0,0 +1,188 @@ +# debug + + tiny node.js debugging utility modelled after node core's debugging technique. + +## Installation + +```bash +$ npm install debug +``` + +## Usage + + With `debug` you simply invoke the exported function to generate your debug function, passing it a name which will determine if a noop function is returned, or a decorated `console.error`, so all of the `console` format string goodies you're used to work fine. A unique color is selected per-function for visibility. + +Example _app.js_: + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %s', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example _worker.js_: + +```js +var debug = require('debug')('worker'); + +setInterval(function(){ + debug('doing some work'); +}, 1000); +``` + + The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples: + + ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png) + + ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png) + +#### Windows note + + On Windows the environment variable is set using the `set` command. + + ```cmd + set DEBUG=*,-not_this + ``` + +Then, run the program to be debugged as usual. + +## Millisecond diff + + When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png) + + When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below: + + ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png) + +## Conventions + + If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". + +## Wildcards + + The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + + You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:". + +## Browser support + + Debug works in the browser as well, currently persisted by `localStorage`. Consider the situation shown below where you have `worker:a` and `worker:b`, and wish to debug both. Somewhere in the code on your page, include: + +```js +window.myDebug = require("debug"); +``` + + ("debug" is a global object in the browser so we give this object a different name.) When your page is open in the browser, type the following in the console: + +```js +myDebug.enable("worker:*") +``` + + Refresh the page. Debug output will continue to be sent to the console until it is disabled by typing `myDebug.disable()` in the console. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + +#### Web Inspector Colors + + Colors are also enabled on "Web Inspectors" that understand the `%c` formatting + option. These are WebKit web inspectors, Firefox ([since version + 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) + and the Firebug plugin for Firefox (any version). + + Colored output looks something like: + + ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png) + +### stderr vs stdout + +You can set an alternative logging method per-namespace by overriding the `log` method on a per-namespace or globally: + +Example _stdout.js_: + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + +### Save debug output to a file + +You can save all debug statements to a file by piping them. + +Example: + +```bash +$ DEBUG_FD=3 node your-app.js 3> whatever.log +``` + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + +## License + +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk <t...@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/debug/bower.json ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/debug/bower.json b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/bower.json new file mode 100644 index 0000000..6af573f --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/bower.json @@ -0,0 +1,28 @@ +{ + "name": "visionmedia-debug", + "main": "dist/debug.js", + "version": "2.2.0", + "homepage": "https://github.com/visionmedia/debug", + "authors": [ + "TJ Holowaychuk <t...@vision-media.ca>" + ], + "description": "visionmedia-debug", + "moduleType": [ + "amd", + "es6", + "globals", + "node" + ], + "keywords": [ + "visionmedia", + "debug" + ], + "license": "MIT", + "ignore": [ + "**/.*", + "node_modules", + "bower_components", + "test", + "tests" + ] +} http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/debug/browser.js ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/debug/browser.js b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/browser.js new file mode 100644 index 0000000..7c76452 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/browser.js @@ -0,0 +1,168 @@ + +/** + * This is the web browser implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = 'undefined' != typeof chrome + && 'undefined' != typeof chrome.storage + ? chrome.storage.local + : localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + 'lightseagreen', + 'forestgreen', + 'goldenrod', + 'dodgerblue', + 'darkorchid', + 'crimson' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +function useColors() { + // is webkit? http://stackoverflow.com/a/16459606/376773 + return ('WebkitAppearance' in document.documentElement.style) || + // is firebug? http://stackoverflow.com/a/398120/376773 + (window.console && (console.firebug || (console.exception && console.table))) || + // is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31); +} + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +exports.formatters.j = function(v) { + return JSON.stringify(v); +}; + + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs() { + var args = arguments; + var useColors = this.useColors; + + args[0] = (useColors ? '%c' : '') + + this.namespace + + (useColors ? ' %c' : ' ') + + args[0] + + (useColors ? '%c ' : ' ') + + '+' + exports.humanize(this.diff); + + if (!useColors) return args; + + var c = 'color: ' + this.color; + args = [args[0], c, 'color: inherit'].concat(Array.prototype.slice.call(args, 1)); + + // the final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + var index = 0; + var lastC = 0; + args[0].replace(/%[a-z%]/g, function(match) { + if ('%%' === match) return; + index++; + if ('%c' === match) { + // we only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); + return args; +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + +function log() { + // this hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return 'object' === typeof console + && console.log + && Function.prototype.apply.call(console.log, console, arguments); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + try { + if (null == namespaces) { + exports.storage.removeItem('debug'); + } else { + exports.storage.debug = namespaces; + } + } catch(e) {} +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + var r; + try { + r = exports.storage.debug; + } catch(e) {} + return r; +} + +/** + * Enable namespaces listed in `localStorage.debug` initially. + */ + +exports.enable(load()); + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage(){ + try { + return window.localStorage; + } catch (e) {} +} http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/debug/component.json ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/debug/component.json b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/component.json new file mode 100644 index 0000000..ca10637 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/component.json @@ -0,0 +1,19 @@ +{ + "name": "debug", + "repo": "visionmedia/debug", + "description": "small debugging utility", + "version": "2.2.0", + "keywords": [ + "debug", + "log", + "debugger" + ], + "main": "browser.js", + "scripts": [ + "browser.js", + "debug.js" + ], + "dependencies": { + "rauchg/ms.js": "0.7.1" + } +} http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/debug/debug.js ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/debug/debug.js b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/debug.js new file mode 100644 index 0000000..7571a86 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/debug.js @@ -0,0 +1,197 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = debug; +exports.coerce = coerce; +exports.disable = disable; +exports.enable = enable; +exports.enabled = enabled; +exports.humanize = require('ms'); + +/** + * The currently active debug mode names, and names to skip. + */ + +exports.names = []; +exports.skips = []; + +/** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lowercased letter, i.e. "n". + */ + +exports.formatters = {}; + +/** + * Previously assigned color. + */ + +var prevColor = 0; + +/** + * Previous log timestamp. + */ + +var prevTime; + +/** + * Select a color. + * + * @return {Number} + * @api private + */ + +function selectColor() { + return exports.colors[prevColor++ % exports.colors.length]; +} + +/** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + +function debug(namespace) { + + // define the `disabled` version + function disabled() { + } + disabled.enabled = false; + + // define the `enabled` version + function enabled() { + + var self = enabled; + + // set `diff` timestamp + var curr = +new Date(); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + // add the `color` if not set + if (null == self.useColors) self.useColors = exports.useColors(); + if (null == self.color && self.useColors) self.color = selectColor(); + + var args = Array.prototype.slice.call(arguments); + + args[0] = exports.coerce(args[0]); + + if ('string' !== typeof args[0]) { + // anything else let's inspect with %o + args = ['%o'].concat(args); + } + + // apply any `formatters` transformations + var index = 0; + args[0] = args[0].replace(/%([a-z%])/g, function(match, format) { + // if we encounter an escaped % then don't increase the array index + if (match === '%%') return match; + index++; + var formatter = exports.formatters[format]; + if ('function' === typeof formatter) { + var val = args[index]; + match = formatter.call(self, val); + + // now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + if ('function' === typeof exports.formatArgs) { + args = exports.formatArgs.apply(self, args); + } + var logFn = enabled.log || exports.log || console.log.bind(console); + logFn.apply(self, args); + } + enabled.enabled = true; + + var fn = exports.enabled(namespace) ? enabled : disabled; + + fn.namespace = namespace; + + return fn; +} + +/** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + +function enable(namespaces) { + exports.save(namespaces); + + var split = (namespaces || '').split(/[\s,]+/); + var len = split.length; + + for (var i = 0; i < len; i++) { + if (!split[i]) continue; // ignore empty strings + namespaces = split[i].replace(/\*/g, '.*?'); + if (namespaces[0] === '-') { + exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + exports.names.push(new RegExp('^' + namespaces + '$')); + } + } +} + +/** + * Disable debug output. + * + * @api public + */ + +function disable() { + exports.enable(''); +} + +/** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + +function enabled(name) { + var i, len; + for (i = 0, len = exports.skips.length; i < len; i++) { + if (exports.skips[i].test(name)) { + return false; + } + } + for (i = 0, len = exports.names.length; i < len; i++) { + if (exports.names[i].test(name)) { + return true; + } + } + return false; +} + +/** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function coerce(val) { + if (val instanceof Error) return val.stack || val.message; + return val; +} http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node.js ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node.js b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node.js new file mode 100644 index 0000000..1d392a8 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node.js @@ -0,0 +1,209 @@ + +/** + * Module dependencies. + */ + +var tty = require('tty'); +var util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +/** + * The file descriptor to write the `debug()` calls to. + * Set the `DEBUG_FD` env variable to override with another value. i.e.: + * + * $ DEBUG_FD=3 node script.js 3>debug.log + */ + +var fd = parseInt(process.env.DEBUG_FD, 10) || 2; +var stream = 1 === fd ? process.stdout : + 2 === fd ? process.stderr : + createWritableStdioStream(fd); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + var debugColors = (process.env.DEBUG_COLORS || '').trim().toLowerCase(); + if (0 === debugColors.length) { + return tty.isatty(fd); + } else { + return '0' !== debugColors + && 'no' !== debugColors + && 'false' !== debugColors + && 'disabled' !== debugColors; + } +} + +/** + * Map %o to `util.inspect()`, since Node doesn't do that out of the box. + */ + +var inspect = (4 === util.inspect.length ? + // node <= 0.8.x + function (v, colors) { + return util.inspect(v, void 0, void 0, colors); + } : + // node > 0.8.x + function (v, colors) { + return util.inspect(v, { colors: colors }); + } +); + +exports.formatters.o = function(v) { + return inspect(v, this.useColors) + .replace(/\s*\n\s*/g, ' '); +}; + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs() { + var args = arguments; + var useColors = this.useColors; + var name = this.namespace; + + if (useColors) { + var c = this.color; + + args[0] = ' \u001b[3' + c + ';1m' + name + ' ' + + '\u001b[0m' + + args[0] + '\u001b[3' + c + 'm' + + ' +' + exports.humanize(this.diff) + '\u001b[0m'; + } else { + args[0] = new Date().toUTCString() + + ' ' + name + ' ' + args[0]; + } + return args; +} + +/** + * Invokes `console.error()` with the specified arguments. + */ + +function log() { + return stream.write(util.format.apply(this, arguments) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + if (null == namespaces) { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } else { + process.env.DEBUG = namespaces; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Copied from `node/src/node.js`. + * + * XXX: It's lame that node doesn't expose this API out-of-the-box. It also + * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame. + */ + +function createWritableStdioStream (fd) { + var stream; + var tty_wrap = process.binding('tty_wrap'); + + // Note stream._type is used for test-module-load-list.js + + switch (tty_wrap.guessHandleType(fd)) { + case 'TTY': + stream = new tty.WriteStream(fd); + stream._type = 'tty'; + + // Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + case 'FILE': + var fs = require('fs'); + stream = new fs.SyncWriteStream(fd, { autoClose: false }); + stream._type = 'fs'; + break; + + case 'PIPE': + case 'TCP': + var net = require('net'); + stream = new net.Socket({ + fd: fd, + readable: false, + writable: true + }); + + // FIXME Should probably have an option in net.Socket to create a + // stream from an existing fd which is writable only. But for now + // we'll just add this hack and set the `readable` member to false. + // Test: ./node test/fixtures/echo.js < /etc/passwd + stream.readable = false; + stream.read = null; + stream._type = 'pipe'; + + // FIXME Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + default: + // Probably an error on in uv_guess_handle() + throw new Error('Implement me. Unknown stream file type!'); + } + + // For supporting legacy API we put the FD here. + stream.fd = fd; + + stream._isStdio = true; + + return stream; +} + +/** + * Enable namespaces listed in `process.env.DEBUG` initially. + */ + +exports.enable(load()); http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/.npmignore ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/.npmignore b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/.npmignore new file mode 100644 index 0000000..d1aa0ce --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/.npmignore @@ -0,0 +1,5 @@ +node_modules +test +History.md +Makefile +component.json http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/History.md ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/History.md b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/History.md new file mode 100644 index 0000000..32fdfc1 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/History.md @@ -0,0 +1,66 @@ + +0.7.1 / 2015-04-20 +================== + + * prevent extraordinary long inputs (@evilpacket) + * Fixed broken readme link + +0.7.0 / 2014-11-24 +================== + + * add time abbreviations, updated tests and readme for the new units + * fix example in the readme. + * add LICENSE file + +0.6.2 / 2013-12-05 +================== + + * Adding repository section to package.json to suppress warning from NPM. + +0.6.1 / 2013-05-10 +================== + + * fix singularization [visionmedia] + +0.6.0 / 2013-03-15 +================== + + * fix minutes + +0.5.1 / 2013-02-24 +================== + + * add component namespace + +0.5.0 / 2012-11-09 +================== + + * add short formatting as default and .long option + * add .license property to component.json + * add version to component.json + +0.4.0 / 2012-10-22 +================== + + * add rounding to fix crazy decimals + +0.3.0 / 2012-09-07 +================== + + * fix `ms(<String>)` [visionmedia] + +0.2.0 / 2012-09-03 +================== + + * add component.json [visionmedia] + * add days support [visionmedia] + * add hours support [visionmedia] + * add minutes support [visionmedia] + * add seconds support [visionmedia] + * add ms string support [visionmedia] + * refactor tests to facilitate ms(number) [visionmedia] + +0.1.0 / 2012-03-07 +================== + + * Initial release http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/LICENSE ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/LICENSE b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/LICENSE new file mode 100644 index 0000000..6c07561 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/LICENSE @@ -0,0 +1,20 @@ +(The MIT License) + +Copyright (c) 2014 Guillermo Rauch <rau...@gmail.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/README.md ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/README.md b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/README.md new file mode 100644 index 0000000..9b4fd03 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/README.md @@ -0,0 +1,35 @@ +# ms.js: miliseconds conversion utility + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('100') // 100 +``` + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(ms('10 hours')) // "10h" +``` + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +- Node/Browser compatible. Published as [`ms`](https://www.npmjs.org/package/ms) in [NPM](http://nodejs.org/download). +- If a number is supplied to `ms`, a string with a unit is returned. +- If a string that contains the number is supplied, it returns it as +a number (e.g: it returns `100` for `'100'`). +- If you pass a string with a number and a valid unit, the number of +equivalent ms is returned. + +## License + +MIT http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/index.js ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/index.js b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/index.js new file mode 100644 index 0000000..4f92771 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/index.js @@ -0,0 +1,125 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} options + * @return {String|Number} + * @api public + */ + +module.exports = function(val, options){ + options = options || {}; + if ('string' == typeof val) return parse(val); + return options.long + ? long(val) + : short(val); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = '' + str; + if (str.length > 10000) return; + var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec(str); + if (!match) return; + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function short(ms) { + if (ms >= d) return Math.round(ms / d) + 'd'; + if (ms >= h) return Math.round(ms / h) + 'h'; + if (ms >= m) return Math.round(ms / m) + 'm'; + if (ms >= s) return Math.round(ms / s) + 's'; + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function long(ms) { + return plural(ms, d, 'day') + || plural(ms, h, 'hour') + || plural(ms, m, 'minute') + || plural(ms, s, 'second') + || ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, n, name) { + if (ms < n) return; + if (ms < n * 1.5) return Math.floor(ms / n) + ' ' + name; + return Math.ceil(ms / n) + ' ' + name + 's'; +} http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/package.json ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/package.json b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/package.json new file mode 100644 index 0000000..7b5d86d --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/node_modules/ms/package.json @@ -0,0 +1,30 @@ +{ + "name": "ms", + "version": "0.7.1", + "description": "Tiny ms conversion utility", + "repository": { + "type": "git", + "url": "git://github.com/guille/ms.js.git" + }, + "main": "./index", + "devDependencies": { + "mocha": "*", + "expect.js": "*", + "serve": "*" + }, + "component": { + "scripts": { + "ms/index.js": "index.js" + } + }, + "readme": "# ms.js: miliseconds conversion utility\n\n```js\nms('2 days') // 172800000\nms('1d') // 86400000\nms('10h') // 36000000\nms('2.5 hrs') // 9000000\nms('2h') // 7200000\nms('1m') // 60000\nms('5s') // 5000\nms('100') // 100\n```\n\n```js\nms(60000) // \"1m\"\nms(2 * 60000) // \"2m\"\nms(ms('10 hours')) // \"10h\"\n```\n\n```js\nms(60000, { long: true }) // \"1 minute\"\nms(2 * 60000, { long: true }) // \"2 minutes\"\nms(ms('10 hours'), { long: true }) // \"10 hours\"\n```\n\n- Node/Browser compatible. Published as [`ms`](https://www.npmjs.org/package/ms) in [NPM](http://nodejs.org/download).\n- If a number is supplied to `ms`, a string with a unit is returned.\n- If a string that contains the number is supplied, it returns it as\na number (e.g: it returns `100` for `'100'`).\n- If you pass a string with a number and a valid unit, the number of\nequivalent ms is returned.\n\n## License\n\nMIT\n", + "readmeFilename": "README.md", + "bugs": { + "url": "https://github.com/guille/ms.js/issues" + }, + "homepage": "https://github.com/guille/ms.js#readme", + "_id": "ms@0.7.1", + "_shasum": "9cd13c03adbff25b65effde7ce864ee952017098", + "_resolved": "https://registry.npmjs.org/ms/-/ms-0.7.1.tgz", + "_from": "ms@0.7.1" +} http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/debug/package.json ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/debug/package.json b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/package.json new file mode 100644 index 0000000..c10c4a8 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/debug/package.json @@ -0,0 +1,51 @@ +{ + "name": "debug", + "version": "2.2.0", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "description": "small debugging utility", + "keywords": [ + "debug", + "log", + "debugger" + ], + "author": { + "name": "TJ Holowaychuk", + "email": "t...@vision-media.ca" + }, + "contributors": [ + { + "name": "Nathan Rajlich", + "email": "nat...@tootallnate.net", + "url": "http://n8.io" + } + ], + "license": "MIT", + "dependencies": { + "ms": "0.7.1" + }, + "devDependencies": { + "browserify": "9.0.3", + "mocha": "*" + }, + "main": "./node.js", + "browser": "./browser.js", + "component": { + "scripts": { + "debug/index.js": "browser.js", + "debug/debug.js": "debug.js" + } + }, + "readme": "# debug\n\n tiny node.js debugging utility modelled after node core's debugging technique.\n\n## Installation\n\n```bash\n$ npm install debug\n```\n\n## Usage\n\n With `debug` you simply invoke the exported function to generate your debug function, passing it a name which will determine if a noop function is returned, or a decorated `console.error`, so all of the `console` format string goodies you're used to work fine. A unique color is selected per-function for visibility.\n\nExample _app.js_:\n\n```js\nvar debug = require('debug')('http')\n , http = require('http')\n , name = 'My App';\n\n// fake app\n\ndebug('booting %s', name);\n\nhttp.createServer(function(req, res){\n debug(req.method + ' ' + req.url);\n res.end('hello\\n');\n}).listen(3000, function(){\n debug('listening');\n});\n\n// fake worker of some kind\n\nrequire('./worker');\n```\n\nExample _worker.js_:\n\n```js\nvar debug = require('debug')('worker');\n\nsetInterval(function(){\n debug('doing som e work');\n}, 1000);\n```\n\n The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:\n\n ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)\n\n ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)\n\n#### Windows note\n\n On Windows the environment variable is set using the `set` command.\n\n ```cmd\n set DEBUG=*,-not_this\n ```\n\nThen, run the program to be debugged as usual.\n\n## Millisecond diff\n\n When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the \"+NNNms\" will show you how much time was spent between calls.\n\n ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)\n\n When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug info rmation as shown below:\n\n ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)\n\n## Conventions\n\n If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use \":\" to separate features. For example \"bodyParser\" from Connect would then be \"connect:bodyParser\".\n\n## Wildcards\n\n The `*` character may be used as a wildcard. Suppose for example your library has debuggers named \"connect:bodyParser\", \"connect:compress\", \"connect:session\", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.\n\n You can also exclude specific debuggers by prefixing them with a \"-\" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with \"connect:\".\n\n## Browser support\n\n Debug works in the browser as well, currently persisted by `localStorage`. Consider the situation shown below where you have `worker:a` and `worker:b`, and wish to debug both. Somewhere in the code on your page, include:\n\n```js\nwindow.myDebug = require(\"debug\");\n```\n\n (\"debug\" is a global object in the browser so we give this object a different name.) When your page is open in the browser, type the following in the console:\n\n```js\nmyDebug.enable(\"worker:*\")\n```\n\n Refresh the page. Debug output will continue to be sent to the console until it is disabled by typing `myDebug.disable()` in the console.\n\n```js\na = debug('worker:a');\nb = debug('worker:b');\n\nsetInterval(function(){\n a('doing some work');\n}, 1000);\n\nsetInterval(function(){\n b('doing some work');\n}, 1200);\n```\n\n#### Web Inspector Colors\n\n Colors are also enabled on \"Web Inspectors\" that understand the `%c` formatting\n option. These are WebKit web inspectors, Firefox ([since version\n 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))\n and the Firebug plugin for Firefox (any version).\n\n Colored output looks something like:\n\n ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)\n\n### stderr vs stdout\n\nYou can set an alternative logging method per-namespace by overriding the `log` method on a per-namespace or globally:\n\nExample _stdout.js_:\n\n```js\nvar debug = require('debug');\nvar error = debug('app:error');\n\n// by default stderr is used\nerror('goes to stderr!');\n\nvar log = debug('app:log');\n// set this namespace to log via console.log\nlog.log = console.log.bind(console); // don't forget to bind to console!\nlog('goes to stdout');\nerror('still goes to stderr!');\n\n// set all output to go via console.info\n// overrid es all per-namespace log settings\ndebug.log = console.info.bind(console);\nerror('now goes to stdout via console.info');\nlog('still goes to stdout, but via console.info now');\n```\n\n### Save debug output to a file\n\nYou can save all debug statements to a file by piping them.\n\nExample:\n\n```bash\n$ DEBUG_FD=3 node your-app.js 3> whatever.log\n```\n\n## Authors\n\n - TJ Holowaychuk\n - Nathan Rajlich\n\n## License\n\n(The MIT License)\n\nCopyright (c) 2014 TJ Holowaychuk <t...@vision-media.ca>\n\nPermission is hereby granted, free of charge, to any person obtaining\na copy of this software and associated documentation files (the\n'Software'), to deal in the Software without restriction, including\nwithout limitation the rights to use, copy, modify, merge, publish,\ndistribute, sublicense, and/or sell copies of the Software, and to\npermit persons to whom the Software is furnished to do so, subject to\nthe following conditions:\n\nThe above copyright notice and this permiss ion notice shall be\nincluded in all copies or substantial portions of the Software.\n\nTHE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,\nEXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF\nMERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.\nIN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY\nCLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,\nTORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE\nSOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.\n", + "readmeFilename": "Readme.md", + "bugs": { + "url": "https://github.com/visionmedia/debug/issues" + }, + "homepage": "https://github.com/visionmedia/debug#readme", + "_id": "debug@2.2.0", + "_shasum": "f87057e995b1a1f6ae6a4960664137bc56f039da", + "_resolved": "https://registry.npmjs.org/debug/-/debug-2.2.0.tgz", + "_from": "debug@>=2.2.0 <2.3.0" +} http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/HISTORY.md ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/HISTORY.md b/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/HISTORY.md new file mode 100644 index 0000000..e51ff01 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/HISTORY.md @@ -0,0 +1,16 @@ +1.0.1 / 2015-09-29 +================== + + * perf: enable strict mode + +1.0.0 / 2014-08-10 +================== + + * Honor `res.statusCode` change in `listener` + * Move to `jshttp` orgainzation + * Prevent `arguments`-related de-opt + +0.0.0 / 2014-05-13 +================== + + * Initial implementation http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/LICENSE ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/LICENSE b/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/LICENSE new file mode 100644 index 0000000..b7dce6c --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/README.md ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/README.md b/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/README.md new file mode 100644 index 0000000..48ed9ae --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/README.md @@ -0,0 +1,76 @@ +# on-headers + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Execute a listener when a response is about to write headers. + +## Installation + +```sh +$ npm install on-headers +``` + +## API + +```js +var onHeaders = require('on-headers') +``` + +### onHeaders(res, listener) + +This will add the listener `listener` to fire when headers are emitted for `res`. +The listener is passed the `response` object as it's context (`this`). Headers are +considered to be emitted only once, right before they are sent to the client. + +When this is called multiple times on the same `res`, the `listener`s are fired +in the reverse order they were added. + +## Examples + +```js +var http = require('http') +var onHeaders = require('on-headers') + +http +.createServer(onRequest) +.listen(3000) + +function addPoweredBy() { + // set if not set by end of request + if (!this.getHeader('X-Powered-By')) { + this.setHeader('X-Powered-By', 'Node.js') + } +} + +function onRequest(req, res) { + onHeaders(res, addPoweredBy) + + res.setHeader('Content-Type', 'text/plain') + res.end('hello!') +} +``` + +## Testing + +```sh +$ npm test +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/on-headers.svg +[npm-url]: https://npmjs.org/package/on-headers +[node-version-image]: https://img.shields.io/node/v/on-headers.svg +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/on-headers/master.svg +[travis-url]: https://travis-ci.org/jshttp/on-headers +[coveralls-image]: https://img.shields.io/coveralls/jshttp/on-headers/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/on-headers?branch=master +[downloads-image]: https://img.shields.io/npm/dm/on-headers.svg +[downloads-url]: https://npmjs.org/package/on-headers http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/index.js ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/index.js b/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/index.js new file mode 100644 index 0000000..089f2b3 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/index.js @@ -0,0 +1,93 @@ +/*! + * on-headers + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Reference to Array slice. + */ + +var slice = Array.prototype.slice + +/** + * Execute a listener when a response is about to write headers. + * + * @param {Object} res + * @return {Function} listener + * @api public + */ + +module.exports = function onHeaders(res, listener) { + if (!res) { + throw new TypeError('argument res is required') + } + + if (typeof listener !== 'function') { + throw new TypeError('argument listener must be a function') + } + + res.writeHead = createWriteHead(res.writeHead, listener) +} + +function createWriteHead(prevWriteHead, listener) { + var fired = false; + + // return function with core name and argument list + return function writeHead(statusCode) { + // set headers from arguments + var args = setWriteHeadHeaders.apply(this, arguments); + + // fire listener + if (!fired) { + fired = true + listener.call(this) + + // pass-along an updated status code + if (typeof args[0] === 'number' && this.statusCode !== args[0]) { + args[0] = this.statusCode + args.length = 1 + } + } + + prevWriteHead.apply(this, args); + } +} + +function setWriteHeadHeaders(statusCode) { + var length = arguments.length + var headerIndex = length > 1 && typeof arguments[1] === 'string' + ? 2 + : 1 + + var headers = length >= headerIndex + 1 + ? arguments[headerIndex] + : undefined + + this.statusCode = statusCode + + // the following block is from node.js core + if (Array.isArray(headers)) { + // handle array case + for (var i = 0, len = headers.length; i < len; ++i) { + this.setHeader(headers[i][0], headers[i][1]) + } + } else if (headers) { + // handle object case + var keys = Object.keys(headers) + for (var i = 0; i < keys.length; i++) { + var k = keys[i] + if (k) this.setHeader(k, headers[k]) + } + } + + // copy leading arguments + var args = new Array(Math.min(length, headerIndex)) + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i] + } + + return args +} http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/package.json ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/package.json b/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/package.json new file mode 100644 index 0000000..513fec8 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/on-headers/package.json @@ -0,0 +1,50 @@ +{ + "name": "on-headers", + "description": "Execute a listener when a response is about to write headers", + "version": "1.0.1", + "author": { + "name": "Douglas Christopher Wilson", + "email": "d...@somethingdoug.com" + }, + "license": "MIT", + "keywords": [ + "event", + "headers", + "http", + "onheaders" + ], + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/on-headers.git" + }, + "dependencies": {}, + "devDependencies": { + "istanbul": "0.3.21", + "mocha": "2.3.3", + "supertest": "1.1.0" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "readme": "# on-headers\n\n[![NPM Version][npm-image]][npm-url]\n[![NPM Downloads][downloads-image]][downloads-url]\n[![Node.js Version][node-version-image]][node-version-url]\n[![Build Status][travis-image]][travis-url]\n[![Test Coverage][coveralls-image]][coveralls-url]\n\nExecute a listener when a response is about to write headers.\n\n## Installation\n\n```sh\n$ npm install on-headers\n```\n\n## API\n\n```js\nvar onHeaders = require('on-headers')\n```\n\n### onHeaders(res, listener)\n\nThis will add the listener `listener` to fire when headers are emitted for `res`.\nThe listener is passed the `response` object as it's context (`this`). Headers are\nconsidered to be emitted only once, right before they are sent to the client.\n\nWhen this is called multiple times on the same `res`, the `listener`s are fired\nin the reverse order they were added.\n\n## Examples\n\n```js\nvar http = require('http')\nvar onHeaders = require('on-headers')\n\nhttp\n.createServer(onRequest)\n.listen (3000)\n\nfunction addPoweredBy() {\n // set if not set by end of request\n if (!this.getHeader('X-Powered-By')) {\n this.setHeader('X-Powered-By', 'Node.js')\n }\n}\n\nfunction onRequest(req, res) {\n onHeaders(res, addPoweredBy)\n\n res.setHeader('Content-Type', 'text/plain')\n res.end('hello!')\n}\n```\n\n## Testing\n\n```sh\n$ npm test\n```\n\n## License\n\n[MIT](LICENSE)\n\n[npm-image]: https://img.shields.io/npm/v/on-headers.svg\n[npm-url]: https://npmjs.org/package/on-headers\n[node-version-image]: https://img.shields.io/node/v/on-headers.svg\n[node-version-url]: http://nodejs.org/download/\n[travis-image]: https://img.shields.io/travis/jshttp/on-headers/master.svg\n[travis-url]: https://travis-ci.org/jshttp/on-headers\n[coveralls-image]: https://img.shields.io/coveralls/jshttp/on-headers/master.svg\n[coveralls-url]: https://coveralls.io/r/jshttp/on-headers?branch=master\n[downloads-image]: https://img.shields.io/npm/dm/on-headers.svg\n[downloads-url]: https://npmjs. org/package/on-headers\n", + "readmeFilename": "README.md", + "bugs": { + "url": "https://github.com/jshttp/on-headers/issues" + }, + "homepage": "https://github.com/jshttp/on-headers#readme", + "_id": "on-headers@1.0.1", + "_shasum": "928f5d0f470d49342651ea6794b0857c100693f7", + "_resolved": "https://registry.npmjs.org/on-headers/-/on-headers-1.0.1.tgz", + "_from": "on-headers@>=1.0.1 <1.1.0" +} http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/vary/HISTORY.md ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/vary/HISTORY.md b/node_modules/cordova-serve/node_modules/compression/node_modules/vary/HISTORY.md new file mode 100644 index 0000000..ed68118 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/vary/HISTORY.md @@ -0,0 +1,29 @@ +1.1.0 / 2015-09-29 +================== + + * Only accept valid field names in the `field` argument + - Ensures the resulting string is a valid HTTP header value + +1.0.1 / 2015-07-08 +================== + + * Fix setting empty header from empty `field` + * perf: enable strict mode + * perf: remove argument reassignments + +1.0.0 / 2014-08-10 +================== + + * Accept valid `Vary` header string as `field` + * Add `vary.append` for low-level string manipulation + * Move to `jshttp` orgainzation + +0.1.0 / 2014-06-05 +================== + + * Support array of fields to set + +0.0.0 / 2014-06-04 +================== + + * Initial release http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/vary/LICENSE ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/vary/LICENSE b/node_modules/cordova-serve/node_modules/compression/node_modules/vary/LICENSE new file mode 100644 index 0000000..142ede3 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/vary/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/vary/README.md ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/vary/README.md b/node_modules/cordova-serve/node_modules/compression/node_modules/vary/README.md new file mode 100644 index 0000000..5966542 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/vary/README.md @@ -0,0 +1,91 @@ +# vary + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Manipulate the HTTP Vary header + +## Installation + +```sh +$ npm install vary +``` + +## API + +```js +var vary = require('vary') +``` + +### vary(res, field) + +Adds the given header `field` to the `Vary` response header of `res`. +This can be a string of a single field, a string of a valid `Vary` +header, or an array of multiple fields. + +This will append the header if not already listed, otherwise leaves +it listed in the current location. + +```js +// Append "Origin" to the Vary header of the response +vary(res, 'Origin') +``` + +### vary.append(header, field) + +Adds the given header `field` to the `Vary` response header string `header`. +This can be a string of a single field, a string of a valid `Vary` header, +or an array of multiple fields. + +This will append the header if not already listed, otherwise leaves +it listed in the current location. The new header string is returned. + +```js +// Get header string appending "Origin" to "Accept, User-Agent" +vary.append('Accept, User-Agent', 'Origin') +``` + +## Examples + +### Updating the Vary header when content is based on it + +```js +var http = require('http') +var vary = require('vary') + +http.createServer(function onRequest(req, res) { + // about to user-agent sniff + vary(res, 'User-Agent') + + var ua = req.headers['user-agent'] || '' + var isMobile = /mobi|android|touch|mini/i.test(ua) + + // serve site, depending on isMobile + res.setHeader('Content-Type', 'text/html') + res.end('You are (probably) ' + (isMobile ? '' : 'not ') + 'a mobile user') +}) +``` + +## Testing + +```sh +$ npm test +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/vary.svg +[npm-url]: https://npmjs.org/package/vary +[node-version-image]: https://img.shields.io/node/v/vary.svg +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/vary/master.svg +[travis-url]: https://travis-ci.org/jshttp/vary +[coveralls-image]: https://img.shields.io/coveralls/jshttp/vary/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/vary +[downloads-image]: https://img.shields.io/npm/dm/vary.svg +[downloads-url]: https://npmjs.org/package/vary http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/vary/index.js ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/vary/index.js b/node_modules/cordova-serve/node_modules/compression/node_modules/vary/index.js new file mode 100644 index 0000000..21dbaf1 --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/vary/index.js @@ -0,0 +1,124 @@ +/*! + * vary + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + */ + +module.exports = vary; +module.exports.append = append; + +/** + * RegExp to match field-name in RFC 7230 sec 3.2 + * + * field-name = token + * token = 1*tchar + * tchar = "!" / "#" / "$" / "%" / "&" / "'" / "*" + * / "+" / "-" / "." / "^" / "_" / "`" / "|" / "~" + * / DIGIT / ALPHA + * ; any VCHAR, except delimiters + */ + +var fieldNameRegExp = /^[!#$%&'\*\+\-\.\^_`\|~0-9A-Za-z]+$/ + +/** + * Append a field to a vary header. + * + * @param {String} header + * @param {String|Array} field + * @return {String} + * @api public + */ + +function append(header, field) { + if (typeof header !== 'string') { + throw new TypeError('header argument is required'); + } + + if (!field) { + throw new TypeError('field argument is required'); + } + + // get fields array + var fields = !Array.isArray(field) + ? parse(String(field)) + : field; + + // assert on invalid field names + for (var i = 0; i < fields.length; i++) { + if (!fieldNameRegExp.test(fields[i])) { + throw new TypeError('field argument contains an invalid header name'); + } + } + + // existing, unspecified vary + if (header === '*') { + return header; + } + + // enumerate current values + var val = header; + var vals = parse(header.toLowerCase()); + + // unspecified vary + if (fields.indexOf('*') !== -1 || vals.indexOf('*') !== -1) { + return '*'; + } + + for (var i = 0; i < fields.length; i++) { + var fld = fields[i].toLowerCase(); + + // append value (case-preserving) + if (vals.indexOf(fld) === -1) { + vals.push(fld); + val = val + ? val + ', ' + fields[i] + : fields[i]; + } + } + + return val; +} + +/** + * Parse a vary header into an array. + * + * @param {String} header + * @return {Array} + * @api private + */ + +function parse(header) { + return header.trim().split(/ *, */); +} + +/** + * Mark that a request is varied on a header field. + * + * @param {Object} res + * @param {String|Array} field + * @api public + */ + +function vary(res, field) { + if (!res || !res.getHeader || !res.setHeader) { + // quack quack + throw new TypeError('res argument is required'); + } + + // get existing header + var val = res.getHeader('Vary') || '' + var header = Array.isArray(val) + ? val.join(', ') + : String(val); + + // set new header + if ((val = append(header, field))) { + res.setHeader('Vary', val); + } +} http://git-wip-us.apache.org/repos/asf/cordova-browser/blob/1d2725bf/node_modules/cordova-serve/node_modules/compression/node_modules/vary/package.json ---------------------------------------------------------------------- diff --git a/node_modules/cordova-serve/node_modules/compression/node_modules/vary/package.json b/node_modules/cordova-serve/node_modules/compression/node_modules/vary/package.json new file mode 100644 index 0000000..777843c --- /dev/null +++ b/node_modules/cordova-serve/node_modules/compression/node_modules/vary/package.json @@ -0,0 +1,48 @@ +{ + "name": "vary", + "description": "Manipulate the HTTP Vary header", + "version": "1.1.0", + "author": { + "name": "Douglas Christopher Wilson", + "email": "d...@somethingdoug.com" + }, + "license": "MIT", + "keywords": [ + "http", + "res", + "vary" + ], + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/vary.git" + }, + "devDependencies": { + "istanbul": "0.3.21", + "mocha": "2.3.3", + "supertest": "1.1.0" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "readme": "# vary\n\n[![NPM Version][npm-image]][npm-url]\n[![NPM Downloads][downloads-image]][downloads-url]\n[![Node.js Version][node-version-image]][node-version-url]\n[![Build Status][travis-image]][travis-url]\n[![Test Coverage][coveralls-image]][coveralls-url]\n\nManipulate the HTTP Vary header\n\n## Installation\n\n```sh\n$ npm install vary\n```\n\n## API\n\n```js\nvar vary = require('vary')\n```\n\n### vary(res, field)\n\nAdds the given header `field` to the `Vary` response header of `res`.\nThis can be a string of a single field, a string of a valid `Vary`\nheader, or an array of multiple fields.\n\nThis will append the header if not already listed, otherwise leaves\nit listed in the current location.\n\n```js\n// Append \"Origin\" to the Vary header of the response\nvary(res, 'Origin')\n```\n\n### vary.append(header, field)\n\nAdds the given header `field` to the `Vary` response header string `header`.\nThis can be a string of a single field, a string of a valid `Vary` h eader,\nor an array of multiple fields.\n\nThis will append the header if not already listed, otherwise leaves\nit listed in the current location. The new header string is returned.\n\n```js\n// Get header string appending \"Origin\" to \"Accept, User-Agent\"\nvary.append('Accept, User-Agent', 'Origin')\n```\n\n## Examples\n\n### Updating the Vary header when content is based on it\n\n```js\nvar http = require('http')\nvar vary = require('vary')\n\nhttp.createServer(function onRequest(req, res) {\n // about to user-agent sniff\n vary(res, 'User-Agent')\n\n var ua = req.headers['user-agent'] || ''\n var isMobile = /mobi|android|touch|mini/i.test(ua)\n\n // serve site, depending on isMobile\n res.setHeader('Content-Type', 'text/html')\n res.end('You are (probably) ' + (isMobile ? '' : 'not ') + 'a mobile user')\n})\n```\n\n## Testing\n\n```sh\n$ npm test\n```\n\n## License\n\n[MIT](LICENSE)\n\n[npm-image]: https://img.shields.io/npm/v/vary.svg\n[npm-url]: https://npmjs.org/pack age/vary\n[node-version-image]: https://img.shields.io/node/v/vary.svg\n[node-version-url]: http://nodejs.org/download/\n[travis-image]: https://img.shields.io/travis/jshttp/vary/master.svg\n[travis-url]: https://travis-ci.org/jshttp/vary\n[coveralls-image]: https://img.shields.io/coveralls/jshttp/vary/master.svg\n[coveralls-url]: https://coveralls.io/r/jshttp/vary\n[downloads-image]: https://img.shields.io/npm/dm/vary.svg\n[downloads-url]: https://npmjs.org/package/vary\n", + "readmeFilename": "README.md", + "bugs": { + "url": "https://github.com/jshttp/vary/issues" + }, + "homepage": "https://github.com/jshttp/vary#readme", + "_id": "vary@1.1.0", + "_shasum": "e1e5affbbd16ae768dd2674394b9ad3022653140", + "_resolved": "https://registry.npmjs.org/vary/-/vary-1.1.0.tgz", + "_from": "vary@>=1.1.0 <1.2.0" +} --------------------------------------------------------------------- To unsubscribe, e-mail: commits-unsubscr...@cordova.apache.org For additional commands, e-mail: commits-h...@cordova.apache.org