Dear RDKit community, I am trying to explain the Explaining bits from Morgan Fingerprints as described in the RDKit getting started guide here ( http://www.rdkit.org/docs/GettingStartedInPython.html#explaining-bits-from-morgan-fingerprints ).
I want to get the SMILES for each bit from morgan FP of this molecule. [image: image.png] I run this python snippet *m = Chem.MolFromSmiles('OC(=O)C1=CC(O)=C(O)C(O)=C1')* *info = {}* *atoms=set()* *for key in Chem.GetMorganFingerprint(m,radius, bitInfo=info).GetNonzeroElements():* * print (key)* * print('fp bit: ', info[key], ' and length is: ', len(info[key]))* * env = Chem.FindAtomEnvironmentOfRadiusN(m,info[key][0][1],info[key][0][0])* * print('Will use the atom: ', info[key][0][0], ' and radius; ', info[key][0][1])* * display(Draw.DrawMorganBit(m, key, info, useSVG=True))* * for bidx in env:* * atoms.add(m.GetBondWithIdx(bidx).GetBeginAtomIdx())* * atoms.add(m.GetBondWithIdx(bidx).GetEndAtomIdx())* * print('atom To Use: ', list(atoms), 'and rooted at atom: ', info[key][0][0])* *smiles = Chem.MolFragmentToSmiles(m,atomsToUse=list(atoms),bondsToUse=env)* * print('Smiles is: ',smiles)* for certain morgan bits such as 994485099 I get the smiles as *c.c.c.O.O.O.ccc*. Which looks a bit weird as it has many non connected fragments. Please see a screen capture below. Although the DrawMorganBits produces the correct image. [image: image.png] Any suggestions where I might be making mistakes? Thanks in Advance. Bilal
_______________________________________________ Rdkit-discuss mailing list Rdkit-discuss@lists.sourceforge.net https://lists.sourceforge.net/lists/listinfo/rdkit-discuss