Apologies if this doubles up, I think sourceforge was having issues...
Hi all,
Is there a way to draw multiple conformers of a single molecule using
Draw.MolsToGridImage?
Here's a first attempt but, either all conformers are exactly the same or
the parent molecule falls back to conformer 0, since all molecules in the
grid appear the same:
```
from rdkit import Chem
from rdkit.Chem import AllChem, Draw
#indomethacin
mol = Chem.MolFromSmiles('Cc1c(c2cc(ccc2n1C(=O)c3ccc(cc3)Cl)OC)CC(=O)O')
mol = Chem.AddHs(mol)
AllChem.EmbedMultipleConfs(mol, numConfs=10)
mol = Chem.RemoveHs(mol)
#drawBonds(mol)
Draw.MolsToGridImage([mol.GetConformer(i).GetOwningMol() for i in
range(10)])
```
Perhaps a simpler question is, how do I access a molecule of a single
conformer in order to draw it?
Thanks!
Lewis
_______________________________________________
Rdkit-discuss mailing list
[email protected]
https://lists.sourceforge.net/lists/listinfo/rdkit-discuss